CAS 10531-41-6: 2-(2-BROMOACETYL)THIOPHENE
Description:2-(2-Bromoacetyl)thiophene is an organic compound characterized by the presence of a thiophene ring substituted with a bromoacetyl group. This compound features a five-membered aromatic ring containing sulfur, which contributes to its unique electronic properties. The bromoacetyl substituent introduces both a halogen and a carbonyl functionality, enhancing its reactivity and potential for further chemical transformations. Typically, compounds like this exhibit moderate to high solubility in organic solvents due to their polar functional groups, while their aromatic nature may confer stability and distinct spectral properties. The presence of the bromine atom can also facilitate nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit interesting biological activities, which can be explored in medicinal chemistry. Overall, 2-(2-Bromoacetyl)thiophene serves as a valuable building block in the synthesis of more complex molecules and materials in various chemical research applications.
Formula:C6H5BrOS
InChI:InChI=1/C6H5BrOS/c7-4-5(8)6-2-1-3-9-6/h1-3H,4H2
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-(Bromoacetyl)thiophene, 97% REF: 02-H51060CAS: 10531-41-6 | 97% | To inquire | Fri 21 Mar 25 |
 | 2-Bromo-1-(thiophen-2-yl)ethanone REF: IN-DA003GLUCAS: 10531-41-6 | 95% | 26.00 €~266.00 € | Thu 27 Mar 25 |
 | 2-(Bromoacetyl)thiophene REF: 54-OR23196CAS: 10531-41-6 | 97% | 31.00 €~188.00 € | Fri 28 Mar 25 |
 | 2-Bromo-1-(thiophen-2-yl)ethanone REF: 10-F064663CAS: 10531-41-6 | 95.0% | To inquire | Tue 08 Apr 25 |
 | 2-(2-Bromoacetyl)thiophene REF: 3D-FB153199CAS: 10531-41-6 | Min. 95% | - - - | Discontinued product |
2-(Bromoacetyl)thiophene, 97%
Ref: 02-H51060
| 5g | To inquire |
2-Bromo-1-(thiophen-2-yl)ethanone
Ref: IN-DA003GLU
| 1g | 50.00 € | ||
| 5g | 115.00 € | ||
| 10g | 174.00 € | ||
| 250mg | 26.00 € |
2-(Bromoacetyl)thiophene
Ref: 54-OR23196
| 1g | 31.00 € | ||
| 5g | 98.00 € | ||
| 10g | 188.00 € |
2-Bromo-1-(thiophen-2-yl)ethanone
Ref: 10-F064663
| 1g | 30.00 € | ||
| 5g | 85.00 € | ||
| 10g | 146.00 € | ||
| 25g | 264.00 € | ||
| 100g | To inquire |
2-(2-Bromoacetyl)thiophene
Ref: 3D-FB153199
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
