CAS 1053656-69-1: 2-[(2-Bromophenyl)methyl]-4-methyl-5-thiazolecarboxylic acid

Description:2-[(2-Bromophenyl)methyl]-4-methyl-5-thiazolecarboxylic acid is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of a bromophenyl group indicates that a bromine atom is substituted on a phenyl ring, contributing to the compound's potential reactivity and biological activity. The carboxylic acid functional group (-COOH) suggests that this compound can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in polar solvents. The methyl groups attached to the thiazole and the phenyl ring can influence the compound's steric properties and overall stability. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to various pharmacological activities. Additionally, the presence of halogen atoms often enhances the lipophilicity of organic compounds, potentially affecting their bioavailability and interaction with biological targets. Overall, this compound's unique structure positions it as a candidate for further research in drug development and chemical synthesis.

Formula:C₁₂H₁₀BrNO₂S

InChI:InChI=1S/C12H10BrNO2S/c1-7-11(12(15)16)17-10(14-7)6-8-4-2-3-5-9(8)13/h2-5H,6H2,1H3,(H,15,16)

InChI key:InChIKey=OBRJANYGAXVVIP-UHFFFAOYSA-N

SMILES:O=C(O)C=1SC(=NC1C)CC=2C=CC=CC2Br

Synonyms:
2-[(2-Bromophenyl)methyl]-4-methyl-5-thiazolecarboxylic acid
5-Thiazolecarboxylic acid, 2-[(2-bromophenyl)methyl]-4-methyl-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2-(2-Bromobenzyl)-4-methylthiazole-5-carboxylic acid REF: 54-OR97551CAS: 1053656-69-1	95+%	230.00 €~825.00 €	Tue 04 Mar 25
2-(2-Bromobenzyl)-4-methylthiazole-5-carboxylic acid REF: 10-F316477CAS: 1053656-69-1	95.0%	To inquire	Thu 13 Mar 25
2-(2-Bromobenzyl)-4-methylthiazole-5-carboxylic acid REF: 3D-DSB65669CAS: 1053656-69-1	Min. 95%	- - -	Discontinued product