CAS 1053657-62-7: 2-[[6-(4-Morpholinyl)-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid hydrazide
Description:2-[[6-(4-Morpholinyl)-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid hydrazide is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a trifluoromethyl group and a morpholine moiety. This compound features a thioether linkage and a hydrazide functional group, contributing to its potential reactivity and biological activity. The presence of the trifluoromethyl group enhances lipophilicity and may influence the compound's pharmacokinetic properties. The morpholine ring can impart specific steric and electronic characteristics, which may affect interactions with biological targets. As a hydrazide, it may exhibit properties typical of hydrazine derivatives, including potential reactivity with carbonyl compounds. This compound is of interest in medicinal chemistry and may be explored for its potential therapeutic applications, particularly in the development of novel pharmaceuticals. Its unique structural features suggest that it could interact with various biological pathways, making it a candidate for further research in drug discovery and development.
Formula:C12H15F3N4O2S
InChI:InChI=1S/C12H15F3N4O2S/c13-12(14,15)8-5-9(19-1-3-21-4-2-19)17-11(6-8)22-7-10(20)18-16/h5-6H,1-4,7,16H2,(H,18,20)
InChI key:InChIKey=CNKFCWHLHVBBBM-UHFFFAOYSA-N
SMILES:O=C(NN)CSC=1N=C(C=C(C1)C(F)(F)F)N2CCOCC2
- Synonyms:
- Acetic acid, 2-[[6-(4-morpholinyl)-4-(trifluoromethyl)-2-pyridinyl]thio]-, hydrazide
- 2-[[6-(4-Morpholinyl)-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid hydrazide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-{[6-Morpholino-4-(trifluoromethyl)pyridin-2-yl]thio}acetohydrazide REF: 10-F316528CAS: 1053657-62-7 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | 2-[6-Morpholin-4-yl-4-(trifluoromethyl)pyridin-2-yl]sulfanylacetohydrazide REF: 3D-DSB65762CAS: 1053657-62-7 | Min. 95% | - - - | Discontinued product |

2-{[6-Morpholino-4-(trifluoromethyl)pyridin-2-yl]thio}acetohydrazide
Ref: 10-F316528
1g | To inquire |

2-[6-Morpholin-4-yl-4-(trifluoromethyl)pyridin-2-yl]sulfanylacetohydrazide
Ref: 3D-DSB65762
500mg | Discontinued | Request information |