CAS 1057672-77-1: 4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine
Description:4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both pyrazole and pyridine rings. This compound features a chlorine atom at the 4-position and two methyl groups at the 1 and 3 positions of the pyrazole ring. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The compound may also display various physical properties such as melting point and boiling point, which are influenced by its molecular structure. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the chlorine substituent. Overall, 4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine is a compound of interest for its potential applications in pharmaceuticals and agrochemicals.
Formula:C8H8ClN3
InChI:InChI=1S/C8H8ClN3/c1-5-7-6(9)3-4-10-8(7)12(2)11-5/h3-4H,1-2H3
InChI key:InChIKey=NJYNJEXXULEPRX-UHFFFAOYSA-N
SMILES:ClC1=CC=NC2=C1C(=NN2C)C
- Synonyms:
- 1H-Pyrazolo[3,4-b]pyridine, 4-chloro-1,3-dimethyl-
- 4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine REF: 3D-HSB67277CAS: 1057672-77-1 | Min. 95% | 221.00 €~1,968.00 € | Thu 08 May 25 |
![]() | 4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine REF: 10-F619009CAS: 1057672-77-1 | 97% | - - - | Discontinued product |

4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine
Ref: 3D-HSB67277
50mg | 571.00 € | ||
500mg | 1,577.00 € |

4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine
Ref: 10-F619009
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |