CAS 1057672-77-1: 4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine

Description: 4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both pyrazole and pyridine rings. This compound features a chlorine atom at the 4-position and two methyl groups at the 1 and 3 positions of the pyrazole ring. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The compound may also display various physical properties such as melting point and boiling point, which are influenced by its molecular structure. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the chlorine substituent. Overall, 4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine is a compound of interest for its potential applications in pharmaceuticals and agrochemicals.

Formula: C₈H₈ClN₃

InChI: InChI=1S/C8H8ClN3/c1-5-7-6(9)3-4-10-8(7)12(2)11-5/h3-4H,1-2H3

InChI key: InChIKey=NJYNJEXXULEPRX-UHFFFAOYSA-N

SMILES: ClC1=CC=NC2=C1C(=NN2C)C

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine, 4-chloro-1,3-dimethyl-
• 4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine

4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine

CAS: 1057672-77-1

Versatile small molecule scaffold

• Formula: C₈H₈ClN₃
• Purity: Min. 95%
• Molecular weight: 181.62 g/mol

4-Chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine

CAS: 1057672-77-1

• Purity: 97%
• Molecular weight: 181.6199951171875