CAS 1059-14-9: Taraxasterol
Description:Taraxasterol is a triterpenoid compound primarily found in various plant species, particularly in the dandelion (Taraxacum officinale). It is characterized by its pentacyclic structure, which is typical of many triterpenes, and exhibits a molecular formula that reflects its complex arrangement of carbon, hydrogen, and oxygen atoms. Taraxasterol is known for its potential biological activities, including anti-inflammatory, antioxidant, and hepatoprotective effects, making it of interest in pharmacological research. The compound is typically extracted from plant sources using methods such as solvent extraction or steam distillation. Its solubility properties are influenced by its hydrophobic nature, which limits its solubility in water but allows for better solubility in organic solvents. Taraxasterol's presence in traditional herbal medicine highlights its significance, and ongoing studies aim to elucidate its mechanisms of action and therapeutic potential. Overall, Taraxasterol represents a valuable compound in both natural product chemistry and medicinal applications.
Formula:C30H50O
InChI:InChI=1S/C30H50O/c1-19-11-14-27(5)17-18-29(7)21(25(27)20(19)2)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h20-25,31H,1,9-18H2,2-8H3/t20-,21-,22+,23-,24+,25-,27-,28+,29-,30-/m1/s1
InChI key:InChIKey=XWMMEBCFHUKHEX-ZJJHUPNDSA-N
SMILES:OC1CCC2(C)C(CCC3(C)C2CCC4C5C(C(=C)CCC5(C)CCC43C)C)C1(C)C
- Synonyms:
- (3Beta,18Alpha,19Alpha)-Urs-20(30)-En-3-Ol
- (3Beta,19Alpha)-Urs-20(30)-En-3-Ol
- (3Beta,5Xi,9Xi,13Xi,18Xi,19Alpha)-Urs-20(30)-En-3-Ol
- (3β,18α,19α)-Urs-20(30)-en-3-ol
- 18α,19β<span class="text-smallcaps">H</span>-Urs-20(30)-en-3β-ol
- 4-Taraxasterol
- Isolactucerol
- Lactucerol
- Saussurol
- Urs-20(30)-en-3-ol, (3.beta.,18.alpha.,19.alpha.)-
- See more synonyms
- Urs-20(30)-en-3-ol, (3β,18α,19α)-
- α-Lactucerol
- Taraxasterol
- 18α,19βH-Urs-20(30)-en-3β-ol
