CAS 1060804-47-8: 3-(Phenylmethoxy)-4-pyridinemethanamine
Description:3-(Phenylmethoxy)-4-pyridinemethanamine, identified by its CAS number 1060804-47-8, is a chemical compound that features a pyridine ring substituted with both a phenylmethoxy group and an amine functional group. This compound typically exhibits characteristics associated with both aromatic and heterocyclic compounds, including potential for hydrogen bonding due to the amine group and lipophilicity from the phenylmethoxy moiety. The presence of the pyridine ring suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can be influenced by the specific functional groups present, as well as the overall molecular structure. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.
Formula:C13H14N2O
InChI:InChI=1S/C13H14N2O/c14-8-12-6-7-15-9-13(12)16-10-11-4-2-1-3-5-11/h1-7,9H,8,10,14H2
InChI key:InChIKey=RSPRNXJIYWXVOP-UHFFFAOYSA-N
SMILES:N=1C=CC(=C(OCC=2C=CC=CC2)C1)CN
- Synonyms:
- 1-[3-(Benzyloxy)pyridin-4-yl]methanamine
- 3-(Phenylmethoxy)-4-pyridinemethanamine
- [3-(Benzyloxy)pyridin-4-yl]methanamine
- 4-Pyridinemethanamine, 3-(phenylmethoxy)-
- (3-Phenylmethoxypyridin-4-yl)methanamine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | [3-(Benzyloxy)pyridin-4-yl]methanamine REF: 3D-KSB80447CAS: 1060804-47-8 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | (3-(Benzyloxy)pyridin-4-yl)methanamine REF: 10-F779954CAS: 1060804-47-8 | 98% | - - - | Discontinued product |

[3-(Benzyloxy)pyridin-4-yl]methanamine
Ref: 3D-KSB80447
50mg | 568.00 € | ||
500mg | 1,565.00 € |

Ref: 10-F779954
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |