CAS 1060817-38-0: 2-Ethyl-5-pyrimidinecarbonitrile
Description:2-Ethyl-5-pyrimidinecarbonitrile is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of the ethyl group at the 2-position and the cyano group (-C≡N) at the 5-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid and is soluble in polar organic solvents. It exhibits moderate stability under standard conditions but may undergo hydrolysis or other reactions in the presence of strong acids or bases. The cyano group imparts notable reactivity, allowing for potential applications in organic synthesis, particularly in the formation of various derivatives. Additionally, compounds containing pyrimidine rings are often of interest in medicinal chemistry due to their biological activity, making 2-Ethyl-5-pyrimidinecarbonitrile a candidate for further research in pharmaceutical applications. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H7N3
InChI:InChI=1S/C7H7N3/c1-2-7-9-4-6(3-8)5-10-7/h4-5H,2H2,1H3
InChI key:InChIKey=MIFBIJDNSKXRMG-UHFFFAOYSA-N
SMILES:N#CC1=CN=C(N=C1)CC
- Synonyms:
- 5-Pyrimidinecarbonitrile, 2-ethyl-
- 2-Ethyl-5-pyrimidinecarbonitrile
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-ETHYL-5-PYRIMIDINECARBONITRILE REF: IN-DA0084EICAS: 1060817-38-0 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 2-ethyl-5-pyrimidinecarbonitrile REF: 10-F311099CAS: 1060817-38-0 | 95.0% | - - - | Discontinued product |
![]() | 2-Ethyl-5-pyrimidinecarbonitrile REF: 3D-KSB81738CAS: 1060817-38-0 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA0084EI
Undefined size | To inquire |

Ref: 10-F311099
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |

2-Ethyl-5-pyrimidinecarbonitrile
Ref: 3D-KSB81738
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
500mg | Discontinued | Request information |