CAS 106138-88-9: (+)-Tamsulosin

Description:(+)-Tamsulosin is a selective alpha-1 adrenergic receptor antagonist primarily used in the treatment of benign prostatic hyperplasia (BPH). It works by relaxing the muscles in the prostate and bladder neck, facilitating easier urination. The compound is characterized by its chiral nature, with the (+) designation indicating its specific optical isomer. Its molecular structure includes a sulfonamide group, which contributes to its pharmacological activity. Tamsulosin exhibits a relatively high bioavailability and is metabolized primarily in the liver, with a half-life that allows for once-daily dosing. The substance is typically administered in capsule form and is known for its favorable side effect profile compared to non-selective alpha blockers. Additionally, it may cause orthostatic hypotension in some patients, although this is less common than with other medications in its class. Overall, (+)-Tamsulosin is an important therapeutic agent in urology, providing symptomatic relief for men with urinary difficulties associated with prostate enlargement.

Formula:C₂₀H₂₈N₂O₅S

InChI:InChI=1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24)/t15-/m0/s1

InChI key:InChIKey=DRHKJLXJIQTDTD-HNNXBMFYSA-N

SMILES:O=S(=O)(N)C1=CC(=CC=C1OC)CC(NCCOC=2C=CC=CC2OCC)C

Synonyms:
(S)-Tamsulosin
5-[(2S)-2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl]-2-methoxybenzenesulfonamide
Benzenesulfonamide, 5-[(2S)-2-[[2-(2-ethoxyphenoxy)ethyl]amino]propyl]-2-methoxy-
Benzenesulfonamide, 5-[2-[[2-(2-ethoxyphenoxy)ethyl]amino]propyl]-2-methoxy-, (S)-
Benzenesulfonamide, 5-[2-[[2-(2-ethoxyphenoxy)ethyl]amino]propyl]-2-methoxy-, (S)- (9CI)
(+)-Tamsulosin