CAS 106266-11-9: 3-{2-[4-(6-hydroxy-1,2-benzisoxazol-3-yl)piperidin-1-yl]ethyl}-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one
Description:The chemical substance known as "3-{2-[4-(6-hydroxy-1,2-benzisoxazol-3-yl)piperidin-1-yl]ethyl}-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one," with the CAS number 106266-11-9, is a complex organic compound characterized by its multi-cyclic structure and the presence of various functional groups. It features a pyrido[1,2-a]pyrimidin-4-one core, which is a bicyclic structure that contributes to its potential biological activity. The compound also contains a piperidine ring, which is known for its role in pharmacological properties, and a hydroxy-substituted benzisoxazole moiety, which may enhance its interaction with biological targets. The presence of multiple rings and substituents suggests that this compound may exhibit significant lipophilicity and potential for binding to various receptors or enzymes. Its structural complexity indicates that it could be of interest in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C23H28N4O3
InChI:InChI=1/C23H28N4O3/c1-15-18(23(29)27-10-3-2-4-21(27)24-15)9-13-26-11-7-16(8-12-26)22-19-6-5-17(28)14-20(19)30-25-22/h5-6,14,16,28H,2-4,7-13H2,1H3
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6-Desfluoro-6-Hydroxy Risperidone
Ref: 4Z-R-0614
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6-Desfluoro-6-hydroxy Risperidone
Controlled ProductRef: TR-D289970
1mg | 590.00 € | ||
2mg | 1,101.00 € | ||
500µg | 343.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6,7,8,9-Tetrahydro-3-[2-[4-(6-hydroxy-1,2-benzisoxazol-3-yl)-1-piperidinyl]ethyl]-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one
Ref: 3D-IT21195
1mg | 889.00 € | ||
2mg | 1,520.00 € | ||
5mg | 2,763.00 € |