CAS 106291-26-3: 3′-Fluoro-4′-hydroxy[1,1′-biphenyl]-4-carboxylic acid
Description:3′-Fluoro-4′-hydroxy[1,1′-biphenyl]-4-carboxylic acid, with the CAS number 106291-26-3, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position and a hydroxy group at the 4′ position on one of the phenyl rings contributes to its unique chemical properties, including potential polar interactions and hydrogen bonding capabilities. The carboxylic acid functional group at the 4 position enhances its acidity and solubility in polar solvents. This compound may exhibit biological activity due to its structural features, making it of interest in pharmaceutical and chemical research. Its molecular structure allows for various applications, including potential use in the synthesis of more complex molecules or as a building block in organic chemistry. Additionally, the presence of fluorine can influence the compound's reactivity and stability, making it a subject of study in materials science and medicinal chemistry.
Formula:C13H9FO3
InChI:InChI=1S/C13H9FO3/c14-11-7-10(5-6-12(11)15)8-1-3-9(4-2-8)13(16)17/h1-7,15H,(H,16,17)
InChI key:InChIKey=WHAOIFHFUMILMM-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(C=C1)C=2C=CC(O)=C(F)C2
- Synonyms:
- 3-Fluoro-4-hydroxy-4′-biphenylcarboxylic acid
- 3′-Fluoro-4′-hydroxy[1,1′-biphenyl]-4-carboxylic acid
- 4-(2-Chloro-4-hydroxyphenyl)benzoic acid
- 4-(2-Fluoro-3-hydroxyphenyl)benzoic acid
- 4-(3-Chloro-2-hydroxyphenyl)benzoic acid
- 4-(3-Fluoro-4-hydroxyphenyl)benzoic acid
- 4-(3-Fluoro-5-hydroxyphenyl)benzoic acid
- 4-(4-Fluoro-2-hydroxyphenyl)benzoic acid
- 4-(5-Fluoro-2-hydroxyphenyl)benzoic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 3′-fluoro-4′-hydroxy-
- See more synonyms
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(2-CHLORO-3-HYDROXYPHENYL)BENZOIC ACID REF: IN-DA0083UHCAS: 106291-26-3 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 4-(3-Fluoro-4-hydroxyphenyl)benzoic acid REF: 10-F639049CAS: 106291-26-3 | 95% | - - - | Discontinued product |
![]() | 3'-Fluoro-4'-Hydroxy-4-Biphenylcarboxylic Acid REF: 3D-FF89802CAS: 106291-26-3 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA0083UH
Undefined size | To inquire |

Ref: 10-F639049
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

3'-Fluoro-4'-Hydroxy-4-Biphenylcarboxylic Acid
Ref: 3D-FF89802
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |