CAS 1065101-28-1: 6-(2-Methoxyphenyl)-2(1H)-pyrimidinethione
Description:6-(2-Methoxyphenyl)-2(1H)-pyrimidinethione is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a methoxyphenyl group at the 6-position enhances its aromatic character and may influence its solubility and reactivity. This compound features a thione functional group, which is a sulfur-containing analogue of a ketone, indicating potential for unique chemical behavior, particularly in nucleophilic reactions. The thione group can participate in tautomeric equilibria with the corresponding thiol form, affecting its stability and reactivity. Additionally, the methoxy group can impact the electronic properties of the molecule, potentially enhancing its lipophilicity and biological activity. Such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Overall, the structural features of 6-(2-Methoxyphenyl)-2(1H)-pyrimidinethione suggest a versatile compound with potential applications in various chemical and biological contexts.
Formula:C11H10N2OS
InChI:InChI=1S/C11H10N2OS/c1-14-10-5-3-2-4-8(10)9-6-7-12-11(15)13-9/h2-7H,1H3,(H,12,13,15)
InChI key:InChIKey=AVRLCQGGAXSRJM-UHFFFAOYSA-N
SMILES:S=C1N=CC=C(N1)C=2C=CC=CC2OC
- Synonyms:
- 2(1H)-Pyrimidinethione, 6-(2-methoxyphenyl)-
- 6-(2-Methoxyphenyl)-2(1H)-pyrimidinethione
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(2-Methoxyphenyl)pyrimidine-2-thiol REF: 54-OR97896CAS: 1065101-28-1 | - - - | To inquire | Fri 28 Mar 25 |
![]() | 4-(2-methoxyphenyl)-2-pyrimidinethiol REF: 10-F313252CAS: 1065101-28-1 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | 4-(2-Methoxyphenyl)-2-pyrimidinethiol REF: 3D-QSB10128CAS: 1065101-28-1 | Min. 95% | - - - | Discontinued product |

Ref: 10-F313252
1g | 167.00 € | ||
5g | To inquire |

4-(2-Methoxyphenyl)-2-pyrimidinethiol
Ref: 3D-QSB10128
10g | Discontinued | Request information | |
25g | Discontinued | Request information |