CAS 1065484-76-5: 2-Bromo-3-(3-pyridinylmethoxy)pyridine
Description:2-Bromo-3-(3-pyridinylmethoxy)pyridine is a chemical compound characterized by its unique structure, which includes a bromine atom and a pyridine ring. This compound features a pyridine moiety substituted with a methoxy group linked to another pyridine ring, contributing to its potential biological activity. The presence of the bromine atom enhances its reactivity and may influence its pharmacological properties. Typically, compounds like this are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The molecular structure suggests that it may exhibit properties such as lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the presence of multiple nitrogen atoms in the pyridine rings may contribute to hydrogen bonding capabilities, influencing its interactions with biological targets. Overall, 2-Bromo-3-(3-pyridinylmethoxy)pyridine represents a class of compounds that are of interest for further research in drug discovery and development.
Formula:C11H9BrN2O
InChI:InChI=1S/C11H9BrN2O/c12-11-10(4-2-6-14-11)15-8-9-3-1-5-13-7-9/h1-7H,8H2
InChI key:InChIKey=UXOJBPUJKPSVBW-UHFFFAOYSA-N
SMILES:BrC1=NC=CC=C1OCC=2C=NC=CC2
- Synonyms:
- Pyridine, 2-bromo-3-(3-pyridinylmethoxy)-
- 2-Bromo-3-(3-pyridinylmethoxy)pyridine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-BroMo-3-(pyridin-3-ylMethoxy)-pyridine, 98+% C11H9BrN2O, MW REF: IN-DA008ZJLCAS: 1065484-76-5 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 2-Bromo-3-(pyridin-3-ylmethoxy)-pyridine REF: 10-F089537CAS: 1065484-76-5 | - - - | - - - | Discontinued product |
![]() | 2-Bromo-3-(pyridin-3-ylmethoxy)-pyridine REF: 3D-QSB48476CAS: 1065484-76-5 | Min. 95% | - - - | Discontinued product |

2-BroMo-3-(pyridin-3-ylMethoxy)-pyridine, 98+% C11H9BrN2O, MW
Ref: IN-DA008ZJL
Undefined size | To inquire |

Ref: 10-F089537
500mg | Discontinued | Request information |

2-Bromo-3-(pyridin-3-ylmethoxy)-pyridine
Ref: 3D-QSB48476
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information | |
2500mg | Discontinued | Request information |