CAS 1065484-82-3: 2-[(4-Chloro-2-pyrimidinyl)oxy]quinoxaline
Description:2-[(4-Chloro-2-pyrimidinyl)oxy]quinoxaline is a chemical compound characterized by its unique structure, which combines a quinoxaline moiety with a pyrimidine derivative. This compound features a chloro substituent on the pyrimidine ring, which can influence its reactivity and biological activity. The presence of the ether linkage (the -O- group) between the pyrimidine and quinoxaline enhances its potential for interactions with various biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The molecular structure suggests that it may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would be necessary to confirm these effects. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, making it essential to consider these factors in practical applications. Overall, 2-[(4-Chloro-2-pyrimidinyl)oxy]quinoxaline represents a class of compounds with significant potential in drug discovery and development.
Formula:C12H7ClN4O
InChI:InChI=1S/C12H7ClN4O/c13-10-5-6-14-12(17-10)18-11-7-15-8-3-1-2-4-9(8)16-11/h1-7H
InChI key:InChIKey=UBKZLXNCQJTZJS-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC=C1)OC2=NC3=CC=CC=C3N=C2
- Synonyms:
- 2-[(4-Chloro-2-pyrimidinyl)oxy]quinoxaline
- Quinoxaline, 2-[(4-chloro-2-pyrimidinyl)oxy]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(4-Chloro-pyrimidin-2-yloxy)-quinoxaline REF: 10-F089543CAS: 1065484-82-3 | - - - | - - - | Discontinued product |
![]() | 2-(4-Chloro-pyrimidin-2-yloxy)-quinoxaline REF: 3D-QSB48482CAS: 1065484-82-3 | Min. 95% | - - - | Discontinued product |

Ref: 10-F089543
500mg | Discontinued | Request information |

2-(4-Chloro-pyrimidin-2-yloxy)-quinoxaline
Ref: 3D-QSB48482
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |