CAS 1068149-98-3: (5R)-1-Ethyl-5-methylpiperazin-2-one

Description:(5R)-1-Ethyl-5-methylpiperazin-2-one is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. The specific configuration at the 5-position, denoted as (5R), indicates that the compound has a particular stereochemistry, which can influence its biological activity and interactions. The presence of an ethyl group at the 1-position and a methyl group at the 5-position contributes to its unique properties, including solubility and reactivity. This compound may exhibit potential pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability, melting point, and solubility in different solvents are important characteristics that can affect its usability in research and development. As with many piperazine derivatives, it may also participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in biological systems.

Formula:C₇H₁₄N₂O

InChI:InChI=1S/C7H14N2O/c1-3-9-5-6(2)8-4-7(9)10/h6,8H,3-5H2,1-2H3/t6-/m1/s1

Synonyms:
2-Piperazinone, 1-ethyl-5-methyl-, (5R)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(R)-1-Ethyl-5-methylpiperazin-2-one REF: IN-DA00HAVJCAS: 1068149-98-3	- - -	To inquire	Tue 04 Mar 25
(R)-1-Ethyl-5-methylpiperazin-2-one REF: 54-OR930067CAS: 1068149-98-3	- - -	To inquire	Mon 03 Mar 25
(R)-1-ethyl-5-methylpiperazin-2-one REF: 10-F600166CAS: 1068149-98-3	95+%	- - -	Discontinued product
(R)-1-Ethyl-5-methylpiperazin-2-one ee REF: 3D-TSB14998CAS: 1068149-98-3	Min. 95%	- - -	Discontinued product