CAS 106840-37-3: ethyl 2-acetamidothiazole-5-carboxylate
Description:Ethyl 2-acetamidothiazole-5-carboxylate is a chemical compound characterized by its unique thiazole ring structure, which contributes to its biological activity and potential applications in medicinal chemistry. This compound features an ethyl ester functional group, an acetamido group, and a carboxylate moiety, making it a versatile molecule for various chemical reactions. The thiazole ring imparts heterocyclic properties, which can enhance its interaction with biological targets. Ethyl 2-acetamidothiazole-5-carboxylate is typically a solid or liquid at room temperature, depending on its purity and formulation. It is soluble in organic solvents, which facilitates its use in organic synthesis and pharmaceutical applications. The compound may exhibit specific pharmacological activities, making it of interest in drug development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents a valuable entity in the field of organic and medicinal chemistry, with potential implications in therapeutic research.
Formula:C8H10N2O3S
InChI:InChI=1/C8H10N2O3S/c1-3-13-7(12)6-4-9-8(14-6)10-5(2)11/h4H,3H2,1-2H3,(H,9,10,11)
- Synonyms:
- 5-Thiazolecarboxylic acid, 2-(acetylamino)-, ethyl ester
- Ethyl 2-acetamido-1,3-thiazole-5-carboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ethyl 2-acetamido-1,3-thiazole-5-carboxylate REF: 54-OR40719CAS: 106840-37-3 | - - - | To inquire | Tue 04 Mar 25 |
![]() | Ethyl 2-acetamidothiazole-5-carboxylate REF: 10-F621889CAS: 106840-37-3 | 98+% | - - - | Discontinued product |
![]() | Ethyl 2-acetamido-1,3-thiazole-5-carboxylate REF: 3D-GEA84037CAS: 106840-37-3 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ethyl 2-acetamido-1,3-thiazole-5-carboxylate
Ref: 54-OR40719
Undefined size | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ethyl 2-acetamidothiazole-5-carboxylate
Ref: 10-F621889
1g | Discontinued | Request information |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ethyl 2-acetamido-1,3-thiazole-5-carboxylate
Ref: 3D-GEA84037
1g | Discontinued | Request information | |
100mg | Discontinued | Request information |