
CAS 1072249-89-8: 3-Methyl-1H-pyrazolo[3,4-c]pyridine
Description:3-Methyl-1H-pyrazolo[3,4-c]pyridine is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings. This compound features a methyl group at the 3-position of the pyrazole ring, which influences its chemical reactivity and properties. It typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. The presence of both nitrogen atoms in the ring structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may exhibit various pharmacological properties, including anti-inflammatory and analgesic effects, due to its ability to interact with biological targets. Its synthesis often involves multi-step organic reactions, and it can be characterized using techniques such as NMR spectroscopy and mass spectrometry. As with many heterocycles, the stability and reactivity of 3-Methyl-1H-pyrazolo[3,4-c]pyridine can be influenced by substituents and the electronic environment of the molecule.
Formula:C7H7N3
InChI:InChI=1S/C7H7N3/c1-5-6-2-3-8-4-7(6)10-9-5/h2-4H,1H3,(H,9,10)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Methyl-1H-pyrazolo[3,4-c]pyridine REF: IN-DA0082F3CAS: 1072249-89-8 | 97% | To inquire | Thu 27 Mar 25 |
![]() | 3-Methyl-1H-pyrazolo[3,4-c]pyridine REF: 10-F219575CAS: 1072249-89-8 | 95.0% | - - - | Discontinued product |
![]() | 3-Methyl-1H-pyrazolo[3,4-c]pyridine REF: 3D-FM141836CAS: 1072249-89-8 | Min. 95% | - - - | Discontinued product |

3-Methyl-1H-pyrazolo[3,4-c]pyridine
Ref: IN-DA0082F3
1g | 247.00 € | ||
100mg | 74.00 € | ||
250mg | 123.00 € |

Ref: 10-F219575
1g | Discontinued | Request information | |
250mg | Discontinued | Request information |

3-Methyl-1H-pyrazolo[3,4-c]pyridine
Ref: 3D-FM141836
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |