CAS 1072945-93-7: B-[3-(4-Nitrophenoxy)phenyl]boronic acid
Description:B-[3-(4-Nitrophenoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a nitrophenoxy group. This compound typically exhibits properties such as being a white to off-white solid, soluble in organic solvents like methanol and dimethyl sulfoxide, but generally less soluble in water due to its hydrophobic aromatic structure. The nitro group contributes to its electronic properties, potentially enhancing its reactivity in various chemical reactions, including Suzuki coupling, which is a common application in organic synthesis for forming carbon-carbon bonds. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them useful in sensing applications and in the development of drug delivery systems. The compound's structure suggests potential applications in medicinal chemistry, particularly in the design of inhibitors or modulators of biological targets. As with many boronic acids, it may also exhibit pH-dependent behavior, influencing its reactivity and solubility in different environments.
Formula:C12H10BNO5
InChI:InChI=1S/C12H10BNO5/c15-13(16)9-2-1-3-12(8-9)19-11-6-4-10(5-7-11)14(17)18/h1-8,15-16H
InChI key:InChIKey=LJQNBOHRIBZDAE-UHFFFAOYSA-N
SMILES:O=N(=O)C1=CC=C(OC2=CC=CC(=C2)B(O)O)C=C1
- Synonyms:
- Boronic acid, B-[3-(4-nitrophenoxy)phenyl]-
- (3-(4-Nitrophenoxy)phenyl)boronic acid
- B-[3-(4-Nitrophenoxy)phenyl]boronic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(4-Nitrophenoxy)phenylboronic acid REF: IN-DA007ESCCAS: 1072945-93-7 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 3-(4-Nitrophenoxy)phenylboronic acid REF: 54-OR360341CAS: 1072945-93-7 | - - - | To inquire | Fri 28 Mar 25 |
![]() | (3-(4-Nitrophenoxy)phenyl)boronic acid REF: 10-F212257CAS: 1072945-93-7 | 95.0% | - - - | Discontinued product |
![]() | 3-(4-Nitrophenoxy)phenylboronic acid REF: 3D-XSB94593CAS: 1072945-93-7 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA007ESC
Undefined size | To inquire |

Ref: 54-OR360341
Undefined size | To inquire |

(3-(4-Nitrophenoxy)phenyl)boronic acid
Ref: 10-F212257
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
25g | Discontinued | Request information |

3-(4-Nitrophenoxy)phenylboronic acid
Ref: 3D-XSB94593
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
500mg | Discontinued | Request information |