![B-[5-Chloro-2-(4-morpholinylcarbonyl)phenyl]boronic acid](https://static.cymitquimica.com/cas-image/267635-b-5-chloro-2-4-morpholinylcarbonyl-phenyl-boronic-acid.png)
CAS 1072946-43-0: B-[5-Chloro-2-(4-morpholinylcarbonyl)phenyl]boronic acid
Description:B-[5-Chloro-2-(4-morpholinylcarbonyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a chloro substituent and a morpholinylcarbonyl group, which contribute to its biological activity and solubility properties. Typically, boronic acids exhibit moderate to high polarity due to the presence of the boron atom and functional groups, influencing their interactions in biological systems. This compound may also exhibit potential as a pharmaceutical agent, particularly in the development of targeted therapies, owing to its ability to interact with specific biological targets. Its structural characteristics suggest it may participate in various chemical reactions, including Suzuki coupling, which is a common method for forming carbon-carbon bonds in organic synthesis. As with many boronic acids, it is essential to handle this compound with care, considering its reactivity and potential environmental impact.
Formula:C11H13BClNO4
InChI:InChI=1S/C11H13BClNO4/c13-8-1-2-9(10(7-8)12(16)17)11(15)14-3-5-18-6-4-14/h1-2,7,16-17H,3-6H2
InChI key:InChIKey=DDFIHSITKHAAKQ-UHFFFAOYSA-N
SMILES:O=C(C1=CC=C(Cl)C=C1B(O)O)N2CCOCC2
- Synonyms:
- Boronic acid, B-[5-chloro-2-(4-morpholinylcarbonyl)phenyl]-
- B-[5-Chloro-2-(4-morpholinylcarbonyl)phenyl]boronic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 5-Chloro-2-(morpholine-4-carbonyl)phenylboronic acid REF: IN-DA003MLZCAS: 1072946-43-0 | - - - | To inquire | Tue 04 Mar 25 |
 | 5-Chloro-2-(morpholine-4-carbonyl)phenylboronic acid REF: 54-OR360979CAS: 1072946-43-0 | - - - | To inquire | Mon 03 Mar 25 |
 | 5-Chloro-2-(morpholine-4-carbonyl)phenylboronic acid REF: 10-F623074CAS: 1072946-43-0 | 97% | - - - | Discontinued product |
 | 5-Chloro-2-(morpholine-4-carbonyl)phenylboronic acid REF: 3D-FC160036CAS: 1072946-43-0 | Min. 95% | - - - | Discontinued product |
5-Chloro-2-(morpholine-4-carbonyl)phenylboronic acid
Ref: IN-DA003MLZ
| Undefined size | To inquire |
Ref: 54-OR360979
| Undefined size | To inquire |
5-Chloro-2-(morpholine-4-carbonyl)phenylboronic acid
Ref: 10-F623074
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
5-Chloro-2-(morpholine-4-carbonyl)phenylboronic acid
Ref: 3D-FC160036
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
