CAS 1072951-79-1: B-[4′-(1-Methylbutoxy)[1,1′-biphenyl]-4-yl]boronic acid
Description:B-[4′-(1-Methylbutoxy)[1,1′-biphenyl]-4-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The compound features a biphenyl structure substituted with a 1-methylbutoxy group, contributing to its hydrophobic characteristics and potentially influencing its solubility and reactivity. Boronic acids are typically polar, and their acidity can vary depending on the substituents attached to the boron atom. This compound may exhibit interesting electronic properties due to the conjugated biphenyl system, which can facilitate charge transfer in electronic applications. Additionally, its structural features suggest potential utility in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Overall, B-[4′-(1-Methylbutoxy)[1,1′-biphenyl]-4-yl]boronic acid represents a versatile building block in both organic and medicinal chemistry.
Formula:C17H21BO3
InChI:InChI=1S/C17H21BO3/c1-3-4-13(2)21-17-11-7-15(8-12-17)14-5-9-16(10-6-14)18(19)20/h5-13,19-20H,3-4H2,1-2H3
InChI key:InChIKey=GHVDSTWRPUFXCV-UHFFFAOYSA-N
SMILES:OB(O)C1=CC=C(C=C1)C=2C=CC(OC(C)CCC)=CC2

(4'-(Pentan-2-yloxy)-[1,1'-biphenyl]-4-yl)boronic acid
Ref: IN-DA003K1K
1g | 167.00 € | ||
5g | 559.00 € |

Ref: 54-OR361520
Undefined size | To inquire |

(4'-(Pentan-2-yloxy)-[1,1'-biphenyl]-4-yl)boronic acid
Ref: 10-F691545
1g | To inquire | ||
5g | To inquire |

4-(4'-(2-Pentyloxy)phenyl)phenylboronic acid
Ref: 3D-XSB95179
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |