CAS 1073353-51-1: N-(2-Hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Description:N-(2-Hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide is a chemical compound characterized by its unique structure, which includes a benzamide moiety and a boron-containing dioxaborolane group. This compound features a hydroxyethyl substituent that enhances its solubility and reactivity in various chemical environments. The presence of the dioxaborolane group suggests potential applications in organic synthesis, particularly in reactions involving boron chemistry, such as cross-coupling reactions. The tetramethyl substitution on the dioxaborolane contributes to the compound's stability and steric hindrance, which can influence its reactivity. Additionally, the hydroxyl group may participate in hydrogen bonding, affecting the compound's physical properties, such as solubility and boiling point. Overall, this compound is of interest in medicinal chemistry and materials science due to its functional groups and potential applications in drug development and polymer chemistry.
Formula:C15H22BNO4
InChI:InChI=1S/C15H22BNO4/c1-14(2)15(3,4)21-16(20-14)12-7-5-11(6-8-12)13(19)17-9-10-18/h5-8,18H,9-10H2,1-4H3,(H,17,19)
InChI key:InChIKey=LOKVHTSZMDAUEL-UHFFFAOYSA-N
SMILES:O=C(NCCO)C1=CC=C(C=C1)B2OC(C)(C)C(O2)(C)C
- Synonyms:
- Benzamide, N-(2-hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- N-(2-Hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(2-Hydroxyethylcarbamoyl)phenylboronic acid, pinacol ester REF: IN-DA007ENMCAS: 1073353-51-1 | 98% | To inquire | Thu 27 Mar 25 |
![]() | 4-(2-Hydroxyethylcarbamoyl)phenylboronic acid, pinacol ester REF: 54-OR361250CAS: 1073353-51-1 | - - - | To inquire | Fri 28 Mar 25 |
![]() | n-(2-Hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide REF: 10-F696667CAS: 1073353-51-1 | 98% | - - - | Discontinued product |
![]() | 4-(2-Hydroxyethylcarbamoyl)phenylboronic acid pinacol ester REF: 3D-YSB35351CAS: 1073353-51-1 | Min. 95% | - - - | Discontinued product |

4-(2-Hydroxyethylcarbamoyl)phenylboronic acid, pinacol ester
Ref: IN-DA007ENM
Undefined size | To inquire |

4-(2-Hydroxyethylcarbamoyl)phenylboronic acid, pinacol ester
Ref: 54-OR361250
Undefined size | To inquire |

n-(2-Hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Ref: 10-F696667
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

4-(2-Hydroxyethylcarbamoyl)phenylboronic acid pinacol ester
Ref: 3D-YSB35351
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
500mg | Discontinued | Request information |