CAS 1074-87-9: 1H-Indole-7-methanol
Description:1H-Indole-7-methanol, with the CAS number 1074-87-9, is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a hydroxymethyl group (-CH2OH) at the 7-position of the indole ring, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxymethyl group. 1H-Indole-7-methanol is of interest in various fields, including medicinal chemistry, due to its potential biological activities, including antimicrobial and anti-inflammatory properties. The compound can participate in various chemical reactions, such as oxidation and substitution, making it a versatile building block in organic synthesis. Its stability and reactivity can be influenced by the surrounding functional groups and the overall molecular environment. As with many indole derivatives, it may also exhibit fluorescence, which can be useful in biological imaging applications.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c11-6-8-3-1-2-7-4-5-10-9(7)8/h1-5,10-11H,6H2
InChI key:InChIKey=UBJBKRMNBMMMHZ-UHFFFAOYSA-N
SMILES:OCC1=CC=CC=2C=CNC21
- Synonyms:
- (1H-Indol-7-yl)methanol
- 1H-Indole-7-methanol
- 1H-indol-7-ylmethanol
- Indole-7-methanol

INDOLE-7-METHANOL
Ref: IN-DA008R5T
1g | 87.00 € | ||
5g | 160.00 € | ||
25g | 556.00 € | ||
250mg | 49.00 € |

Ref: 10-F303167
1g | 60.00 € | ||
5g | 167.00 € | ||
10g | 302.00 € | ||
25g | 708.00 € |

7-(Hydroxymethyl)-1H-indole
Ref: 54-OR10509
500mg | 203.00 € |

Indole-7-methanol
Ref: 3D-FI151211
2g | 331.00 € | ||
5g | 448.00 € | ||
10g | 664.00 € |