CAS 107426-70-0

3-[2-[(4-azido-2-hydroxy-benzoyl)amino]ethyldisulfanyl]propanoic acid

Description:

3-[2-[(4-azido-2-hydroxy-benzoyl)amino]ethyldisulfanyl]propanoic acid, with the CAS number 107426-70-0, is a chemical compound characterized by its complex structure that includes an azido group, a hydroxy group, and a disulfide linkage. The presence of the azido group (-N3) suggests potential for click chemistry applications, making it useful in bioconjugation and labeling studies. The hydroxy group contributes to its solubility in polar solvents and may participate in hydrogen bonding, influencing its reactivity and interaction with biological molecules. The disulfide bond provides stability under certain conditions but can be cleaved under reducing environments, which is significant for applications in drug delivery and biomolecular engineering. This compound's unique functional groups enable it to serve as a versatile building block in organic synthesis and medicinal chemistry, particularly in the development of targeted therapies and diagnostic agents. Its properties, including solubility, reactivity, and stability, are essential for its application in various chemical and biological contexts.

Formula: C₁₂H₁₄N₄O₄S₂

InChI: InChI=1/C12H14N4O4S2/c13-16-15-8-1-2-9(10(17)7-8)12(20)14-4-6-22-21-5-3-11(18)19/h1-2,7,17H,3-6H2,(H,14,20)(H,18,19)

SMILES: c1cc(c(cc1N=[N+]=[NH-])O)C(=NCCSSCCC(=O)O)O