CAS 107452-89-1: omega-conotoxin mviia
Description:Omega-conotoxin MVIIA is a peptide derived from the venom of the marine cone snail, Conus magus. It is classified as a neurotoxin and is known for its potent ability to selectively block N-type voltage-gated calcium channels (VGCCs), which play a crucial role in neurotransmitter release and pain signaling. This characteristic makes omega-conotoxin MVIIA a subject of interest in pain management research and potential therapeutic applications. The peptide consists of 25 amino acids and features a unique structure stabilized by disulfide bonds, contributing to its stability and specificity. Its mechanism of action involves binding to the calcium channels, inhibiting calcium influx, and thereby reducing neurotransmitter release, which can alleviate pain sensations. Omega-conotoxin MVIIA has been studied for its potential use in treating chronic pain conditions and has implications in neuroscience research, particularly in understanding pain pathways and synaptic transmission. As a research compound, it is often utilized in pharmacological studies to explore its effects on neuronal activity and pain modulation.
Formula:C102H172N36O32S7
InChI:InChI=1/C102H172N36O32S7/c1-50(2)34-63-91(161)127-62(26-33-171-5)90(160)129-64(35-53-22-24-54(143)25-23-53)92(162)130-65(36-78(148)149)93(163)135-72-48-175-173-45-69(80(108)150)133-86(156)58(18-8-12-29-105)121-76(146)39-117-85(155)66(41-139)131-88(158)61(21-15-32-114-102(111)112)126-96(166)70-46-176-177-47-71(97(167)132-68(43-141)95(165)125-60(87(157)128-63)20-14-31-113-101(109)110)134-89(159)59(19-9-13-30-106)123-81(151)51(3)119-74(144)37-115-83(153)56(16-6-10-27-103)120-75(145)38-116-84(154)57(17-7-11-28-104)124-82(152)55(107)44-172-174-49-73(137-98(72)168)99(169)138-79(52(4)142)100(170)118-40-77(147)122-67(42-140)94(164)136-70/h22-25,50-52,55-73,79,139-143H,6-21,26-49,103-107H2,1-5H3,(H2,108,150)(H,115,153)(H,116,154)(H,117,155)(H,118,170)(H,119,144)(H,120,145)(H,121,146)(H,122,147)(H,123,151)(H,124,152)(H,125,165)(H,126,166)(H,127,161)(H,128,157)(H,129,160)(H,130,162)(H,131,158)(H,132,167)(H,133,156)(H,134,159)(H,135,163)(H,136,164)(H,137,168)(H,138,169)(H,148,149)(H4,109,110,113)(H4,111,112,114)
- Synonyms:
- Conotoxin MVIIA
- H-Cys-Lys-Gly-Lys-Gly-Ala-Lys-Cys-Ser-Arg-Leu-Met-Tyr-Asp-Cys-Cys-Thr-Gly-Ser-Cys-Arg-Ser-Gly-Lys-Cys-NH2 (Disulfide bonds between Cys1 and Cys16/Cys8 and Cys20/ Cys15 and Cys25)
- Ziconotide
- Ziconotide Acetate