CAS 1076-28-4: 2-methyl-1-oxo-1,2-dihydroquinolinium
Description:2-Methyl-1-oxo-1,2-dihydroquinolinium, with the CAS number 1076-28-4, is a chemical compound that belongs to the class of quinolinium derivatives. It features a quinoline-like structure, characterized by a fused bicyclic system containing a nitrogen atom. This compound typically exhibits a yellow to brown color and is soluble in polar organic solvents. Its molecular structure includes a methyl group and a carbonyl group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the quinolinium moiety suggests that it may possess interesting biological activities, including antimicrobial or antitumor properties, although specific biological data may vary. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and the presence of other functional groups. Overall, 2-methyl-1-oxo-1,2-dihydroquinolinium is of interest in various fields, including pharmaceuticals and materials science, due to its unique structural features and potential applications.
Formula:C10H10NO
InChI:InChI=1/C10H10NO/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-8H,1H3/q+1
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Methylquinoline 1-oxide REF: IN-DA009QWGCAS: 1076-28-4 | 98% | To inquire | Thu 27 Mar 25 |
![]() | 2-Methylquinoline N-Oxide REF: 3B-M3000CAS: 1076-28-4 | >98.0%(GC) | 71.00 €~228.00 € | Tue 01 Apr 25 |
![]() | 2-Methylquinoline 1-oxide REF: 10-F763937CAS: 1076-28-4 | 98% GC | To inquire | Tue 08 Apr 25 |
![]() | 2-Methylquinoline N-Oxide REF: 3D-BAA07628CAS: 1076-28-4 | Min. 95% | - - - | Discontinued product |

2-Methylquinoline 1-oxide
Ref: IN-DA009QWG
1g | 81.00 € | ||
5g | 184.00 € | ||
25g | To inquire | ||
200mg | 42.00 € | ||
250mg | 51.00 € |

2-Methylquinoline N-Oxide
Ref: 3B-M3000
1g | 71.00 € | ||
5g | 228.00 € |

Ref: 10-F763937
1g | To inquire | ||
5g | To inquire | ||
25g | To inquire | ||
200mg | To inquire |

2-Methylquinoline N-Oxide
Ref: 3D-BAA07628
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |