
CAS 1078163-00-4: 2-Pyrrolidinecarboxamide, N-2-thiazolyl-, hydrochloride (1:1)
Description:2-Pyrrolidinecarboxamide, N-2-thiazolyl-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and a thiazole moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous environments, which is crucial for biological and pharmaceutical applications. The presence of the thiazole group contributes to its potential biological activity, as thiazoles are known for their roles in various medicinal chemistry contexts. The compound may exhibit properties such as moderate to high polarity, influencing its interaction with biological targets. Additionally, its hydrochloride form suggests that it may be stable under standard laboratory conditions, making it suitable for further research and development. As with many amides, it may participate in hydrogen bonding, affecting its reactivity and solubility. Overall, this compound's unique structural characteristics position it as a candidate for exploration in drug development and other chemical applications.
Formula:C8H11N3OS·ClH
InChI:InChI=1S/C8H11N3OS.ClH/c12-7(6-2-1-3-9-6)11-8-10-4-5-13-8;/h4-6,9H,1-3H2,(H,10,11,12);1H
InChI key:InChIKey=LACUEEOLQDNDDC-UHFFFAOYSA-N
SMILES:Cl.O=C(NC1=NC=CS1)C2NCCC2
- Synonyms:
- 2-Pyrrolidinecarboxamide, N-2-thiazolyl-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | n-(1,3-Thiazol-2-yl)pyrrolidine-2-carboxamide hydrochloride REF: 10-F661095CAS: 1078163-00-4 | 98% | - - - | Discontinued product |
![]() | N-(1,3-Thiazol-2-yl)pyrrolidine-2-carboxamide hydrochloride REF: 3D-DTB16300CAS: 1078163-00-4 | Min. 95% | - - - | Discontinued product |

n-(1,3-Thiazol-2-yl)pyrrolidine-2-carboxamide hydrochloride
Ref: 10-F661095
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

N-(1,3-Thiazol-2-yl)pyrrolidine-2-carboxamide hydrochloride
Ref: 3D-DTB16300
1g | Discontinued | Request information | |
100mg | Discontinued | Request information |