
CAS 1078163-23-1: 2-Pyrrolidinecarboxamide, N-(2,5-dichlorophenyl)-, hydrochloride (1:1)
Description:2-Pyrrolidinecarboxamide, N-(2,5-dichlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered ring containing one nitrogen atom. The presence of the N-(2,5-dichlorophenyl) group indicates that the compound has a dichlorophenyl substituent attached to the nitrogen atom of the pyrrolidine, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability for pharmaceutical applications. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutic agents. Its structure suggests potential interactions with biological targets, making it of interest in drug discovery. Safety and handling precautions should be observed, as with all chemical substances, due to the potential for toxicity or adverse effects. Further studies would be necessary to fully elucidate its pharmacological profile and applications.
Formula:C11H12Cl2N2O·ClH
InChI:InChI=1S/C11H12Cl2N2O.ClH/c12-7-3-4-8(13)10(6-7)15-11(16)9-2-1-5-14-9;/h3-4,6,9,14H,1-2,5H2,(H,15,16);1H
InChI key:InChIKey=QPMYMYGWFHXAAP-UHFFFAOYSA-N
SMILES:Cl.O=C(NC1=CC(Cl)=CC=C1Cl)C2NCCC2
- Synonyms:
- 2-Pyrrolidinecarboxamide, N-(2,5-dichlorophenyl)-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | n-(2,5-Dichlorophenyl)pyrrolidine-2-carboxamide hydrochloride REF: 10-F662011CAS: 1078163-23-1 | 95% | - - - | Discontinued product |
![]() | N-(2,5-Dichlorophenyl)pyrrolidine-2-carboxamide hydrochloride REF: 3D-DTB16323CAS: 1078163-23-1 | Min. 95% | - - - | Discontinued product |

n-(2,5-Dichlorophenyl)pyrrolidine-2-carboxamide hydrochloride
Ref: 10-F662011
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

N-(2,5-Dichlorophenyl)pyrrolidine-2-carboxamide hydrochloride
Ref: 3D-DTB16323
50mg | Discontinued | Request information | |
500mg | Discontinued | Request information |