CAS 108166-02-5: 2-Methyl-6-quinolinemethanol
Description:2-Methyl-6-quinolinemethanol is an organic compound characterized by its quinoline structure, which features a fused bicyclic system containing a nitrogen atom. This compound typically exhibits properties associated with both alcohols and heterocyclic compounds. It is likely to be a pale yellow to brown solid or liquid, depending on its purity and specific conditions. The presence of the hydroxyl (-OH) group suggests it can engage in hydrogen bonding, influencing its solubility in polar solvents like water and alcohols. Additionally, the methyl group at the 2-position and the hydroxymethyl group at the 6-position contribute to its unique reactivity and potential biological activity. Compounds of this type may exhibit antimicrobial or anti-inflammatory properties, making them of interest in medicinal chemistry. The molecular structure allows for various functionalization possibilities, which can be explored for synthetic applications. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C11H11NO
InChI:InChI=1S/C11H11NO/c1-8-2-4-10-6-9(7-13)3-5-11(10)12-8/h2-6,13H,7H2,1H3
InChI key:InChIKey=HLFYJILNIBADGG-UHFFFAOYSA-N
SMILES:OCC=1C=CC=2N=C(C=CC2C1)C
- Synonyms:
- (2-Methylquinolin-6-yl)methanol
- 2-Methyl-6-quinolinemethanol
- 6-(Hydroxymethyl)-2-methylquinoline
- 6-Quinolinemethanol, 2-methyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (2-Methylquinolin-6-yl)methanol REF: IN-DA003HQJCAS: 108166-02-5 | 95% | 34.00 €~185.00 € | Thu 27 Mar 25 |
![]() | 6-(Hydroxymethyl)-2-methylquinoline REF: 54-OR14489CAS: 108166-02-5 | - - - | 223.00 €~620.00 € | Fri 28 Mar 25 |
![]() | (2-Methylquinolin-6-yl)methanol REF: 10-F229121CAS: 108166-02-5 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | 6-(Hydroxymethyl)-2-methylquinoline REF: 3D-IEA16602CAS: 108166-02-5 | Min. 95% | - - - | Discontinued product |

(2-Methylquinolin-6-yl)methanol
Ref: IN-DA003HQJ
1g | 83.00 € | ||
100mg | 34.00 € | ||
250mg | 53.00 € |

6-(Hydroxymethyl)-2-methylquinoline
Ref: 54-OR14489
1g | 223.00 € | ||
5g | 620.00 € |

(2-Methylquinolin-6-yl)methanol
Ref: 10-F229121
1g | 83.00 € | ||
5g | To inquire |

6-(Hydroxymethyl)-2-methylquinoline
Ref: 3D-IEA16602
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |