CAS 1086391-06-1: Methyl 3-bromo-1H-indazole-5-carboxylate

Description:Methyl 3-bromo-1H-indazole-5-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 3-position and a carboxylate group at the 5-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The methyl ester functional group enhances its solubility in organic solvents, making it suitable for various chemical reactions. This compound may exhibit biological activity, which is often explored in drug discovery and development. Its molecular structure allows for potential interactions with biological targets, making it of interest in pharmacological studies. Additionally, the presence of halogen substituents like bromine can influence the compound's electronic properties and reactivity, potentially leading to unique chemical behavior. Overall, Methyl 3-bromo-1H-indazole-5-carboxylate is a versatile compound with significant implications in research and development within the fields of chemistry and biochemistry.

Formula:C₉H₇BrN₂O₂

InChI:InChI=1S/C9H7BrN2O2/c1-14-9(13)5-3-2-4-6-7(5)8(10)12-11-6/h2-4H,1H3,(H,11,12)

Synonyms:
1H-Indazole-5-carboxylic acid, 3-bromo-, methyl ester

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Methyl 3-bromo-1H-indazole-5-carboxylate REF: IN-DA0083E6CAS: 1086391-06-1	97%	25.00 €~283.00 €	Tue 04 Mar 25
Methyl 3-bromo-1H-indazole-5-carboxylate REF: 10-F788334CAS: 1086391-06-1	98%	78.00 €~323.00 €	Wed 05 Mar 25
Methyl 3-bromo-1H-indazole-5-carboxylate REF: 54-OR471693CAS: 1086391-06-1	0.99	97.00 €~482.00 €	Tue 11 Mar 25
Methyl 3-bromo-1H-indazole-5-carboxylate REF: 3D-LTB39106CAS: 1086391-06-1	Min. 95%	To inquire	Tue 15 Apr 25
Methyl 3-bromoindazole-5-carboxylate REF: 10-F236935CAS: 1086391-06-1	95.0%	- - -	Discontinued product