CAS 1086395-71-2: 2-(Phenylmethyl)-2,7-diazaspiro[4.5]decane
Description:2-(Phenylmethyl)-2,7-diazaspiro[4.5]decane is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework containing two nitrogen atoms. This compound belongs to the class of spiro compounds, which are known for their distinctive arrangement of atoms that creates a three-dimensional shape. The presence of the phenylmethyl group contributes to its aromatic characteristics, potentially influencing its reactivity and interaction with biological systems. The diazaspiro structure suggests that it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's molecular interactions could be influenced by the nitrogen atoms, which may participate in hydrogen bonding or coordination with metal ions. Additionally, the overall hydrophobicity and lipophilicity of the molecule can affect its solubility and permeability, important factors in drug design. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is studied, including temperature, solvent, and pH.
Formula:C15H22N2
InChI:InChI=1S/C15H22N2/c1-2-5-14(6-3-1)11-17-10-8-15(13-17)7-4-9-16-12-15/h1-3,5-6,16H,4,7-13H2
InChI key:InChIKey=YLMCYUHQYITSIZ-UHFFFAOYSA-N
SMILES:C=1C=CC(=CC1)CN2CCC3(CNCCC3)C2
- Synonyms:
- 2-(Phenylmethyl)-2,7-diazaspiro[4.5]decane
- 2,7-Diazaspiro[4.5]decane, 2-(phenylmethyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-benzyl-2,7-diazaspiro[4.5]decane REF: IN-DA008SDUCAS: 1086395-71-2 | 95% | To inquire | Thu 27 Mar 25 |
![]() | 2-Benzyl-2,7-diazaspiro[4.5]decane REF: 10-F610032CAS: 1086395-71-2 | 97% | 444.00 €~764.00 € | Tue 01 Apr 25 |
![]() | 2-Benzyl-2,7-diazaspiro[4.5]decane REF: 54-OR470851CAS: 1086395-71-2 | - - - | To inquire | Thu 03 Apr 25 |
![]() | 2-Benzyl-2,7-diazaspiro[4.5]decane REF: 3D-LTB39571CAS: 1086395-71-2 | Min. 95% | - - - | Discontinued product |

2-benzyl-2,7-diazaspiro[4.5]decane
Ref: IN-DA008SDU
1g | To inquire | ||
100mg | 339.00 € | ||
250mg | 640.00 € |

Ref: 10-F610032
1g | 764.00 € | ||
250mg | 444.00 € |

2-Benzyl-2,7-diazaspiro[4.5]decane
Ref: 3D-LTB39571
1g | Discontinued | Request information | |
5mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |