CAS 1087784-28-8: 1-[[5-(Ethoxycarbonyl)-2-furanyl]sulfonyl]-4-piperidinecarboxylic acid

Description: 1-[[5-(Ethoxycarbonyl)-2-furanyl]sulfonyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring, a furan moiety, and a sulfonyl group. The presence of the ethoxycarbonyl group contributes to its solubility and reactivity, making it a potential candidate for various chemical reactions. This compound is likely to exhibit properties typical of both acidic and basic functional groups due to the carboxylic acid and piperidine components. Its sulfonyl group may enhance its ability to participate in nucleophilic substitution reactions. Additionally, the furan ring can provide aromatic stability and may influence the compound's electronic properties. The overall molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from literature for precise applications.

Formula: C₁₃H₁₇NO₇S

InChI: InChI=1S/C13H17NO7S/c1-2-20-13(17)10-3-4-11(21-10)22(18,19)14-7-5-9(6-8-14)12(15)16/h3-4,9H,2,5-8H2,1H3,(H,15,16)

InChI key: InChIKey=PPRPMPFQBMZZFG-UHFFFAOYSA-N

SMILES: O=C(OCC)C=1OC(=CC1)S(=O)(=O)N2CCC(C(=O)O)CC2

Synonyms:

• 4-Piperidinecarboxylic acid, 1-[[5-(ethoxycarbonyl)-2-furanyl]sulfonyl]-
• 1-[[5-(Ethoxycarbonyl)-2-furanyl]sulfonyl]-4-piperidinecarboxylic acid

1-{[5-(Ethoxycarbonyl)furan-2-yl]sulfonyl}piperidine-4-carboxylic acid

CAS: 1087784-28-8

1-{[5-(Ethoxycarbonyl)furan-2-yl]sulfonyl}piperidine-4-carboxylic acid is a synthetic peptide that is used as research tool for pharmacology, cell …

• Formula: C₁₃H₁₇NO₇S
• Purity: Min. 95%
• Molecular weight: 331.34 g/mol

1-{[5-(ethoxycarbonyl)furan-2-yl]sulfonyl}piperidine-4-carboxylic acid

CAS: 1087784-28-8

• Purity: 95%
• Molecular weight: 331.3399963378906