CAS 1087792-09-3: 5-Chloro-2-[(2-furanylmethyl)amino]-4-pyrimidinecarboxylic acid
Description:5-Chloro-2-[(2-furanylmethyl)amino]-4-pyrimidinecarboxylic acid is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing nitrogen atoms. The presence of a chloro substituent at the 5-position and a furanylmethylamino group at the 2-position contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit polar characteristics due to the carboxylic acid functional group, which can participate in hydrogen bonding and influence its solubility in polar solvents. The furan moiety may also impart additional properties, such as the ability to engage in π-π stacking interactions. Given its structural features, this compound may be of interest in medicinal chemistry, particularly for its potential as a pharmaceutical agent. Its specific interactions and biological effects would depend on further studies, including its mechanism of action and pharmacokinetics. As with many heterocyclic compounds, it may also exhibit interesting properties in terms of reactivity and synthesis, making it a candidate for further research in organic and medicinal chemistry.
Formula:C10H8ClN3O3
InChI:InChI=1S/C10H8ClN3O3/c11-7-5-13-10(14-8(7)9(15)16)12-4-6-2-1-3-17-6/h1-3,5H,4H2,(H,15,16)(H,12,13,14)
InChI key:InChIKey=OIGSTMMHDNRYPP-UHFFFAOYSA-N
SMILES:O=C(O)C1=NC(=NC=C1Cl)NCC=2OC=CC2
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-Chloro-2-[(furan-2-ylmethyl)amino]pyrimidine-4-carboxylic acid REF: 10-F661928CAS: 1087792-09-3 | 95% | - - - | Discontinued product |
![]() | 5-Chloro-2-[(furan-2-ylmethyl)amino]pyrimidine-4-carboxylic acid REF: 3D-MTB79209CAS: 1087792-09-3 | Min. 95% | - - - | Discontinued product |

5-Chloro-2-[(furan-2-ylmethyl)amino]pyrimidine-4-carboxylic acid
Ref: 10-F661928
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

5-Chloro-2-[(furan-2-ylmethyl)amino]pyrimidine-4-carboxylic acid
Ref: 3D-MTB79209
50mg | Discontinued | Request information | |
500mg | Discontinued | Request information |