CAS 1091606-69-7: (1S,2S)-2-(Diphenylphosphino)-2,3-dihydro-1H-inden-1-amine
Description:(1S,2S)-2-(Diphenylphosphino)-2,3-dihydro-1H-inden-1-amine is a chiral organophosphorus compound characterized by the presence of a diphenylphosphino group attached to a bicyclic indene structure. This compound features a nitrogen atom in its amine functional group, contributing to its potential as a ligand in coordination chemistry. The stereochemistry indicated by the (1S,2S) configuration suggests specific spatial arrangements that can influence its reactivity and interactions with metal centers in catalysis. The presence of both phosphorus and nitrogen atoms allows for diverse coordination modes, making it valuable in various applications, including asymmetric synthesis and catalysis. Additionally, the diphenylphosphino moiety enhances its ability to stabilize metal complexes, which can be crucial in facilitating chemical transformations. Overall, this compound exemplifies the intersection of organophosphorus chemistry and coordination chemistry, showcasing its potential utility in synthetic methodologies and materials science.
Formula:C21H20NP
InChI:InChI=1S/C21H20NP/c22-21-19-14-8-7-9-16(19)15-20(21)23(17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-14,20-21H,15,22H2/t20-,21-/m0/s1
InChI key:InChIKey=IALYUOSURKZWLR-SFTDATJTSA-N
SMILES:NC1C=2C=CC=CC2CC1P(C=3C=CC=CC3)C=4C=CC=CC4
- Synonyms:
- (1S,2S)-2-(Diphenylphosphino)-2,3-dihydro-1H-inden-1-amine
- 1H-Inden-1-amine, 2-(diphenylphosphino)-2,3-dihydro-, (1S,2S)-

(1S,2S)-2-(Diphenylphosphino)-2,3-dihydro-1H-inden-1-amine, min. 97% (10wt% in THF)
Ref: 08-15-7111
1g | 77.00 € | ||
5g | 272.00 € |

(1S,2S)-2-(Diphenylphosphino)-2,3-dihydro-1H-inden-1-amine
Ref: IN-DA003BJ1
1g | To inquire | ||
100mg | 614.00 € | ||
250mg | To inquire |

(1S,2S)-2-(Diphenylphosphino)-2,3-dihydro-1H-inden-1-amine
Ref: 10-F215584
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

(1S,2S)-2-(Diphenylphosphino)-2,3-dihydro-1H-inden-1-amine
Ref: 3D-RTB60669
5g | Discontinued | Request information | |
10g | Discontinued | Request information |