CAS 109232-76-0: Camellianin B

Description:Camellianin B is a flavonoid compound primarily derived from plants in the Camellia genus, particularly noted for its presence in tea leaves. It exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. The compound is characterized by its polyphenolic structure, which contributes to its ability to scavenge free radicals and modulate various biochemical pathways. Camellianin B is soluble in organic solvents and has limited solubility in water, typical of many flavonoids. Its stability can be influenced by factors such as pH and light exposure, which may affect its efficacy in biological systems. Research into Camellianin B continues to explore its potential health benefits and mechanisms of action, particularly in the context of chronic diseases. Overall, this compound represents a significant area of interest within natural product chemistry and nutraceutical development.

Formula:C₂₇H₃₀O₁₄

InChI:InChI=1S/C27H30O14/c1-10-20(32)21(33)23(35)26(37-10)41-25-18(9-28)40-27(24(36)22(25)34)39-17-7-13(30)6-16-19(17)14(31)8-15(38-16)11-2-4-12(29)5-3-11/h2-8,10,18,20-30,32-36H,9H2,1H3/t10-,18+,20-,21+,22+,23+,24+,25+,26-,27+/m0/s1

InChI key:InChIKey=LRFDUPNLCDXZOE-ZLDQKHMLSA-N

SMILES:O=C1C=C(OC2=CC(O)=CC(OC3OC(CO)C(OC4OC(C)C(O)C(O)C4O)C(O)C3O)=C12)C=5C=CC(O)=CC5

Synonyms:
4H-1-Benzopyran-4-one, 5-[[4-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-7-hydroxy-2-(4-hydroxyphenyl)-
5-[[4-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-7-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
Camellianin B

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Camellianin B REF: 11-1416SCAS: 109232-76-0	(HPLC) ≥98%	171.00 €	Mon 24 Feb 25
Camellianin B REF: TM-T38481CAS: 109232-76-0	- - -	1,444.00 €	Tue 04 Mar 25
Camellianin B REF: 3D-JEA23276CAS: 109232-76-0	Min. 95%	To inquire	Mon 14 Apr 25