CAS 1092350-27-0: 6-Chloro-8-fluoro-2,3-dihydro-4H-1-benzopyran-4-one
Description:6-Chloro-8-fluoro-2,3-dihydro-4H-1-benzopyran-4-one is a synthetic organic compound characterized by its unique bicyclic structure, which includes a benzopyran moiety. This compound features a chloro group at the 6-position and a fluoro group at the 8-position, contributing to its chemical reactivity and potential biological activity. The presence of the dihydro group indicates that it has a saturated ring system, which can influence its stability and solubility in various solvents. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of halogen substituents often enhances lipophilicity, potentially affecting the compound's bioavailability and distribution in biological systems. Overall, 6-Chloro-8-fluoro-2,3-dihydro-4H-1-benzopyran-4-one represents a versatile scaffold for further chemical modifications and investigations in drug development.
Formula:C9H6ClFO2
InChI:InChI=1S/C9H6ClFO2/c10-5-3-6-8(12)1-2-13-9(6)7(11)4-5/h3-4H,1-2H2
InChI key:InChIKey=WKZNUTWJAOYUBQ-UHFFFAOYSA-N
SMILES:O=C1C=2C=C(Cl)C=C(F)C2OCC1
- Synonyms:
- 6-Chloro-8-fluorochroman-4-one
- 4H-1-Benzopyran-4-one, 6-chloro-8-fluoro-2,3-dihydro-
- 6-Chloro-8-fluoro-2,3-dihydro-4H-1-benzopyran-4-one
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6-CHLORO-8-FLUOROCHROMAN-4-ONE REF: IN-DA00967QCAS: 1092350-27-0 | 95% | 69.00 €~119.00 € | Tue 04 Mar 25 |
![]() | 6-Chloro-8-fluorochroman-4-one REF: 54-PC101387CAS: 1092350-27-0 | 0.95 | 261.00 €~762.00 € | Mon 03 Mar 25 |
![]() | 6-Chloro-8-fluorochroman-4-one REF: 10-F497710CAS: 1092350-27-0 | 95.0% | 49.00 €~388.00 € | Wed 05 Mar 25 |
![]() | 6-Chloro-8-fluorochroman-4-one REF: 3D-STB35027CAS: 1092350-27-0 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6-CHLORO-8-FLUOROCHROMAN-4-ONE
Ref: IN-DA00967Q
100mg | 69.00 € | ||
250mg | 119.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 10-F497710
1g | 388.00 € | ||
100mg | 49.00 € | ||
250mg | 109.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6-Chloro-8-fluorochroman-4-one
Ref: 3D-STB35027
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |