CAS 1092961-05-1: 3,5-Dimethyl-4-pyridinecarbothioamide

Description: 3,5-Dimethyl-4-pyridinecarbothioamide is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of two methyl groups at the 3 and 5 positions of the pyridine ring contributes to its hydrophobic character and influences its reactivity. The carbothioamide functional group, which features a carbon atom double-bonded to sulfur and single-bonded to an amine, imparts unique chemical properties, including potential nucleophilicity and the ability to form hydrogen bonds. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions. Additionally, the compound's structure suggests potential for various chemical reactions, including thiol formation and substitution reactions. Overall, 3,5-Dimethyl-4-pyridinecarbothioamide is a versatile compound with applications in research and industry, particularly in the synthesis of more complex molecules.

Formula: C₈H₁₀N₂S

InChI: InChI=1S/C8H10N2S/c1-5-3-10-4-6(2)7(5)8(9)11/h3-4H,1-2H3,(H2,9,11)

InChI key: InChIKey=XXRQNNFAWGOBAF-UHFFFAOYSA-N

SMILES: S=C(N)C=1C(=CN=CC1C)C

Synonyms:

• 4-Pyridinecarbothioamide, 3,5-dimethyl-
• 3,5-Dimethyl-4-pyridinecarbothioamide

3,5-Dimethylthioisonicotinamide

CAS: 1092961-05-1

• Formula: C₈H₁₀N₂S
• Purity: 95%
• Molecular weight: 166.2434

3,5-Dimethylpyridine-4-carbothioamide

CAS: 1092961-05-1

• Purity: 95+%
• Molecular weight: 166.24000549316406