CAS 1094222-85-1: 3,4-Dihydro-6,7-dimethoxy-2(1H)-isoquinolinesulfonamide
Description:3,4-Dihydro-6,7-dimethoxy-2(1H)-isoquinolinesulfonamide is a chemical compound characterized by its isoquinoline structure, which includes a bicyclic aromatic system. This compound features two methoxy groups (-OCH3) at the 6 and 7 positions, contributing to its unique chemical properties and potential biological activity. The sulfonamide functional group (-SO2NH2) is also present, which is known for its role in medicinal chemistry, particularly in the development of antimicrobial agents. The presence of the dihydro group indicates that the compound is partially saturated, which can influence its reactivity and stability. This compound may exhibit various pharmacological activities, making it of interest in drug discovery and development. Its specific interactions and mechanisms of action would require further investigation through experimental studies. Overall, 3,4-Dihydro-6,7-dimethoxy-2(1H)-isoquinolinesulfonamide represents a complex organic molecule with potential applications in medicinal chemistry.
Formula:C11H16N2O4S
InChI:InChI=1S/C11H16N2O4S/c1-16-10-5-8-3-4-13(18(12,14)15)7-9(8)6-11(10)17-2/h5-6H,3-4,7H2,1-2H3,(H2,12,14,15)
InChI key:InChIKey=YDCHIXAESCPAOW-UHFFFAOYSA-N
SMILES:O=S(=O)(N)N1CC2=CC(OC)=C(OC)C=C2CC1
- Synonyms:
- 2(1H)-Isoquinolinesulfonamide, 3,4-dihydro-6,7-dimethoxy-
- 3,4-Dihydro-6,7-dimethoxy-2(1H)-isoquinolinesulfonamide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinoline-2-sulfonamide REF: 3D-UTB22285CAS: 1094222-85-1 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 6,7-Dimethoxy-3,4-dihydroisoquinoline-2(1H)-sulfonamide REF: 10-F614776CAS: 1094222-85-1 | 95% | - - - | Discontinued product |

6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinoline-2-sulfonamide
Ref: 3D-UTB22285
1g | 828.00 € | ||
100mg | 391.00 € |

6,7-Dimethoxy-3,4-dihydroisoquinoline-2(1H)-sulfonamide
Ref: 10-F614776
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |