CAS 1096770-58-9: (3R,4S)-4-Aminotetrahydro-2H-pyran-3-ol
Description:(3R,4S)-4-Aminotetrahydro-2H-pyran-3-ol is a chemical compound characterized by its bicyclic structure, which includes a pyran ring. This compound features an amino group (-NH2) and a hydroxyl group (-OH) attached to the tetrahydropyran framework, contributing to its potential as a chiral building block in organic synthesis. The stereochemistry indicated by the (3R,4S) configuration suggests specific spatial arrangements of the substituents, which can influence the compound's reactivity and interactions in biological systems. It is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features allow for potential applications in synthesizing more complex molecules or as intermediates in pharmaceutical formulations. As with many amines and alcohols, it may also participate in various chemical reactions, including nucleophilic substitutions and condensation reactions.
Formula:C5H11NO2
InChI:InChI=1S/C5H11NO2/c6-4-1-2-8-3-5(4)7/h4-5,7H,1-3,6H2/t4-,5-/m0/s1
InChI key:InChIKey=PBQHDTRHGNGTLZ-WHFBIAKZSA-N
SMILES:OC1COCCC1N
- Synonyms:
- L-threo-Pentitol, 3-amino-1,5-anhydro-2,3-dideoxy-
- (3R,4S)-4-Aminotetrahydro-2H-pyran-3-ol
- (3R,4S)-4-Amino-tetrahydropyran-3-ol
- 3-Amino-1,5-anhydro-2,3-dideoxy-L-threo-pentitol
- (+)-(3R,4S)-4-Aminotetrahydro-2H-pyran-3-ol
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Trans-4-aminotetrahydro-2H-pyran-3-ol hydrochloride REF: 10-F429583CAS: 1096770-58-9 | 95.0% | To inquire | Tue 11 Mar 25 |
 | (3R,4S)-4-Aminotetrahydro-2H-pyran-3-ol REF: TR-A630010CAS: 1096770-58-9 | - - - | 1,568.00 € | Fri 11 Apr 25 |
| (3R,4S)-4-Aminotetrahydro-2H-pyran-3-ol REF: 10-F622385CAS: 1096770-58-9 | 98% | - - - | Discontinued product |
 | Trans-4-amino-tetrahydro-pyran-3-ol hydrochloride REF: 3D-WTB77058CAS: 1096770-58-9 | Min. 95% | - - - | Discontinued product |
Trans-4-aminotetrahydro-2H-pyran-3-ol hydrochloride
Ref: 10-F429583
| 250mg | To inquire |
(3R,4S)-4-Aminotetrahydro-2H-pyran-3-ol
Controlled ProductRef: TR-A630010
| 500mg | 1,568.00 € |
(3R,4S)-4-Aminotetrahydro-2H-pyran-3-ol
Ref: 10-F622385
| 1g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
Trans-4-amino-tetrahydro-pyran-3-ol hydrochloride
Ref: 3D-WTB77058
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
