CAS 1098340-27-2: Methyl 4-(trifluoromethyl)-1H-indole-2-carboxylate
Description:Methyl 4-(trifluoromethyl)-1H-indole-2-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a trifluoromethyl group (-CF3) at the 4-position of the indole ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. The carboxylate group, esterified with a methyl group, contributes to its reactivity, making it a useful intermediate in organic synthesis. This compound is often utilized in medicinal chemistry and material science due to its unique electronic properties and potential applications in drug development. Its molecular structure allows for various substitution reactions, making it versatile in synthetic pathways. Additionally, the trifluoromethyl group can impart desirable pharmacokinetic properties, such as increased metabolic stability. As with many fluorinated compounds, it is essential to handle it with care due to potential environmental and health impacts associated with fluorinated substances.
Formula:C11H8F3NO2
InChI:InChI=1S/C11H8F3NO2/c1-17-10(16)9-5-6-7(11(12,13)14)3-2-4-8(6)15-9/h2-5,15H,1H3
InChI key:InChIKey=HEEQKKQXILYZNF-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC=2C(=CC=CC2C(F)(F)F)N1
- Synonyms:
- Methyl 4-(trifluoromethyl)-1H-indole-2-carboxylate
- 1H-Indole-2-carboxylic acid, 4-(trifluoromethyl)-, methyl ester
Methyl 4-(trifluoromethyl)-1H-indole-2-carboxylate
Ref: IN-DA0096JW
| 5g | To inquire | ||
| 100mg | 49.00 € | ||
| 250mg | 71.00 € |
Methyl 4-(trifluoromethyl)-1H-indole-2-carboxylate
Ref: 54-PC103899
| 1g | 368.00 € | ||
| 5g | 1,595.00 € |
Methyl 4-(trifluoromethyl)-1H-indole-2-carboxylate
Ref: 10-F498555
| 1g | To inquire | ||
| 250mg | 72.00 € |
Methyl 4-(trifluoromethyl)-1H-indole-2-carboxylate
Ref: 3D-YTB34027
| 2500mg | 628.00 € |
