CAS 1101120-53-9: 5-Bromopyrazolo[1,5-a]pyridine-3-carboxaldehyde

Description: 5-Bromopyrazolo[1,5-a]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its unique pyrazolo and pyridine ring structures, which contribute to its chemical reactivity and potential biological activity. The presence of a bromine atom enhances its electrophilic properties, making it a useful intermediate in various synthetic applications. The aldehyde functional group at the 3-position is significant for its reactivity, allowing for further derivatization and potential interactions in biological systems. This compound is typically used in medicinal chemistry and research due to its potential as a scaffold for drug development. Its solubility and stability can vary depending on the solvent and conditions, and it may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy. Overall, 5-Bromopyrazolo[1,5-a]pyridine-3-carboxaldehyde is a versatile compound with applications in organic synthesis and pharmacology, warranting further investigation into its properties and potential uses.

Formula: C₈H₅BrN₂O

InChI: InChI=1S/C8H5BrN2O/c9-7-1-2-11-8(3-7)6(5-12)4-10-11/h1-5H

InChI key: InChIKey=PDZJMEHDPABUAI-UHFFFAOYSA-N

SMILES: O=CC=1C=NN2C=CC(Br)=CC12

Synonyms:

• Pyrazolo[1,5-a]pyridine-3-carboxaldehyde, 5-bromo-
• 5-Bromopyrazolo[1,5-a]pyridine-3-carboxaldehyde

5-Bromopyrazolo[1,5-a]pyridine-3-carbaldehyde

CAS: 1101120-53-9

• Purity: 97%
• Molecular weight: 225.0449981689453

5-Bromo-1H-pyrazolo[1,5-a]pyridine-3-carbaldehyde

CAS: 1101120-53-9

Versatile small molecule scaffold

• Formula: C₈H₅BrN₂O
• Purity: Min. 95%
• Molecular weight: 225.04 g/mol