CAS 110139-48-5: ethyl 2,5,8-trimethylquinoline-3-carboxylate
Description:Ethyl 2,5,8-trimethylquinoline-3-carboxylate is an organic compound belonging to the quinoline family, characterized by its complex bicyclic structure that includes a quinoline moiety and an ester functional group. This compound features three methyl groups at the 2, 5, and 8 positions of the quinoline ring, which contribute to its hydrophobic nature and influence its physical properties. The presence of the ethyl ester group at the 3-position enhances its solubility in organic solvents. Ethyl 2,5,8-trimethylquinoline-3-carboxylate may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its molecular structure suggests potential applications in the synthesis of dyes, pharmaceuticals, or agrochemicals. Additionally, the compound's stability and reactivity can be influenced by the steric hindrance introduced by the methyl groups, which may affect its interactions in various chemical environments. As with many quinoline derivatives, it may also display fluorescence properties, making it useful in analytical applications.
Formula:C15H17NO2
InChI:InChI=1/C15H17NO2/c1-5-18-15(17)13-8-12-9(2)6-7-10(3)14(12)16-11(13)4/h6-8H,5H2,1-4H3
- Synonyms:
- 3-Quinolinecarboxylic Acid, 2,5,8-Trimethyl-, Ethyl Ester
- Ethyl 2,5,8-trimethylquinoline-3-carboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,5,8-Trimethylquinoline-3-carboxylic acid ethyl ester REF: 54-OR307879CAS: 110139-48-5 | - - - | 328.00 €~720.00 € | Thu 03 Apr 25 |
![]() | Ethyl 2,5,8-trimethylquinoline-3-carboxylate REF: 10-F735241CAS: 110139-48-5 | 98% | - - - | Discontinued product |
![]() | 2,5,8-Trimethylquinoline-3-carboxylic acid ethyl ester REF: 3D-KEA13948CAS: 110139-48-5 | Min. 95% | - - - | Discontinued product |

Ref: 54-OR307879
1g | 328.00 € | ||
5g | 720.00 € |

Ethyl 2,5,8-trimethylquinoline-3-carboxylate
Ref: 10-F735241
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information |

2,5,8-Trimethylquinoline-3-carboxylic acid ethyl ester
Ref: 3D-KEA13948
5g | Discontinued | Request information | |
10g | Discontinued | Request information |