CAS 1105192-95-7: 2-Amino-N-ethyl-4-thiazolepropanamide
Description:2-Amino-N-ethyl-4-thiazolepropanamide is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group (-NH2) and an ethyl substituent on the nitrogen atom, contributing to its basicity and potential reactivity. The presence of the thiazole moiety suggests that it may exhibit biological activity, as thiazole derivatives are often found in pharmaceuticals and agrochemicals. The propanamide functional group indicates that it has an amide bond, which can influence its solubility and stability. The compound's molecular structure allows for various interactions, including hydrogen bonding, which can affect its physical properties such as melting point and solubility in polar solvents. Additionally, the compound may participate in various chemical reactions typical of amines and amides, making it a candidate for further research in medicinal chemistry or material science. Overall, 2-Amino-N-ethyl-4-thiazolepropanamide presents interesting characteristics that warrant exploration for potential applications.
Formula:C8H13N3OS
InChI:InChI=1S/C8H13N3OS/c1-2-10-7(12)4-3-6-5-13-8(9)11-6/h5H,2-4H2,1H3,(H2,9,11)(H,10,12)
InChI key:InChIKey=GXGRTYMTESLDFI-UHFFFAOYSA-N
SMILES:O=C(NCC)CCC=1N=C(SC1)N
- Synonyms:
- 4-Thiazolepropanamide, 2-amino-N-ethyl-
- 2-Amino-N-ethyl-4-thiazolepropanamide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(2-amino-1,3-thiazol-4-yl)-N-ethylpropanamide REF: 10-F711011CAS: 1105192-95-7 | 95% | - - - | Discontinued product |
![]() | 3-(2-Amino-1,3-thiazol-4-yl)-N-ethylpropanamide REF: 3D-FUB19295CAS: 1105192-95-7 | Min. 95% | - - - | Discontinued product |

3-(2-amino-1,3-thiazol-4-yl)-N-ethylpropanamide
Ref: 10-F711011
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

3-(2-Amino-1,3-thiazol-4-yl)-N-ethylpropanamide
Ref: 3D-FUB19295
10mg | Discontinued | Request information | |
100mg | Discontinued | Request information |