CAS 1105194-37-3: 4-Ethoxy-N-[(tetrahydro-2-furanyl)methyl]-2-benzothiazolamine

Description: 4-Ethoxy-N-[(tetrahydro-2-furanyl)methyl]-2-benzothiazolamine is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety and an ethoxy group. The presence of the tetrahydro-2-furanyl group suggests that the compound may exhibit interesting reactivity and potential biological activity, possibly due to the furan ring's electron-rich nature. This compound is likely to be a solid at room temperature, given the presence of multiple functional groups that can contribute to intermolecular interactions. Its solubility may vary depending on the solvent, with potential solubility in polar organic solvents due to the ethoxy group. The benzothiazole structure is known for its applications in pharmaceuticals and agrochemicals, indicating that this compound may have potential therapeutic or industrial applications. Additionally, the presence of nitrogen in the amine functional group could suggest basic properties, influencing its reactivity and interaction with other chemical species. Overall, this compound's unique structure may lead to diverse applications in medicinal chemistry and materials science.

Formula: C₁₄H₁₈N₂O₂S

InChI: InChI=1S/C14H18N2O2S/c1-2-17-11-6-3-7-12-13(11)16-14(19-12)15-9-10-5-4-8-18-10/h3,6-7,10H,2,4-5,8-9H2,1H3,(H,15,16)

InChI key: InChIKey=GIINJJKXRKHQNR-UHFFFAOYSA-N

SMILES: N1=C(SC=2C=CC=C(OCC)C12)NCC3OCCC3

Synonyms:

• 4-Ethoxy-N-[(tetrahydro-2-furanyl)methyl]-2-benzothiazolamine
• 2-Benzothiazolamine, 4-ethoxy-N-[(tetrahydro-2-furanyl)methyl]-

4-ethoxy-N-(tetrahydrofuran-2-ylmethyl)-1,3-benzothiazol-2-amine

CAS: 1105194-37-3

• Purity: 95.0%
• Molecular weight: 278.3699951171875

4-Ethoxy-N-(tetrahydrofuran-2-ylmethyl)-1,3-benzothiazol-2-amine

CAS: 1105194-37-3

Versatile small molecule scaffold

• Formula: C₁₄H₁₈N₂O₂S
• Purity: Min. 95%
• Molecular weight: 278.37 g/mol