CAS 1105194-98-6: 3-Chloro-6-(5-methyl-2-thienyl)pyridazine

Description: 3-Chloro-6-(5-methyl-2-thienyl)pyridazine is a heterocyclic organic compound characterized by its pyridazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a 5-methyl-2-thienyl group at the 6-position contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic thienyl group, which can influence its solubility and reactivity. The chlorine substituent may impart electrophilic characteristics, making it a potential candidate for further chemical modifications or reactions. Additionally, the thienyl group can participate in various interactions, such as π-π stacking and dipole-dipole interactions, which may affect its biological activity and potential applications in pharmaceuticals or agrochemicals. Overall, 3-Chloro-6-(5-methyl-2-thienyl)pyridazine represents a versatile structure with potential utility in synthetic chemistry and medicinal chemistry research.

Formula: C₉H₇ClN₂S

InChI: InChI=1S/C9H7ClN2S/c1-6-2-4-8(13-6)7-3-5-9(10)12-11-7/h2-5H,1H3

InChI key: InChIKey=LFRIRVPPUDPRLH-UHFFFAOYSA-N

SMILES: ClC=1N=NC(=CC1)C=2SC(=CC2)C

Synonyms:

• Pyridazine, 3-chloro-6-(5-methyl-2-thienyl)-
• 3-Chloro-6-(5-methyl-2-thienyl)pyridazine

3-Chloro-6-(5-methylthiophen-2-yl)pyridazine

CAS: 1105194-98-6

• Purity: 98%
• Molecular weight: 210.67999267578125

3-Chloro-6-(5-methyl-2-thienyl)pyridazine

CAS: 1105194-98-6

Please enquire for more information about 3-Chloro-6-(5-methyl-2-thienyl)pyridazine including the price, delivery time and more detailed …

• Formula: C₉H₇ClN₂S
• Purity: Min. 95%
• Molecular weight: 210.68 g/mol