CAS 1105195-30-9: N3-(4-Methoxy-2-benzothiazolyl)-N1,N1-dimethyl-1,3-propanediamine
Description:N3-(4-Methoxy-2-benzothiazolyl)-N1,N1-dimethyl-1,3-propanediamine, identified by its CAS number 1105195-30-9, is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety and a propanediamine backbone. This compound typically exhibits properties associated with both amines and heterocyclic compounds, such as potential basicity and the ability to participate in hydrogen bonding. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and biological activity. Compounds of this nature are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific interactions and stability of this compound can be influenced by factors such as pH, temperature, and the presence of other chemical species. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C13H19N3OS
InChI:InChI=1S/C13H19N3OS/c1-16(2)9-5-8-14-13-15-12-10(17-3)6-4-7-11(12)18-13/h4,6-7H,5,8-9H2,1-3H3,(H,14,15)
InChI key:InChIKey=AYBCWVZAODOWBA-UHFFFAOYSA-N
SMILES:N1=C(SC=2C=CC=C(OC)C12)NCCCN(C)C
- Synonyms:
- 1,3-Propanediamine, N3-(4-methoxy-2-benzothiazolyl)-N1,N1-dimethyl-
- N3-(4-Methoxy-2-benzothiazolyl)-N1,N1-dimethyl-1,3-propanediamine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N'-(4-Methoxy-1,3-benzothiazol-2-yl)-N,N-dimethylpropane-1,3-diamine REF: 3D-FUB19530CAS: 1105195-30-9 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | n'-(4-methoxy-1,3-benZothiazol-2-yl)-n,n-dimethylpropane-1,3-diamine REF: 10-F657586CAS: 1105195-30-9 | 95% | - - - | Discontinued product |

N'-(4-Methoxy-1,3-benzothiazol-2-yl)-N,N-dimethylpropane-1,3-diamine
Ref: 3D-FUB19530
1g | 1,150.00 € | ||
100mg | 462.00 € |

n'-(4-methoxy-1,3-benZothiazol-2-yl)-n,n-dimethylpropane-1,3-diamine
Ref: 10-F657586
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |