CAS 1105511-68-9: B-[1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl]boronic acid
Description:B-[1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl]boronic acid is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and a pyrazole moiety. This compound features a tetrahydro-2H-pyran ring, which contributes to its structural complexity and potential reactivity. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis and medicinal chemistry. The presence of the pyrazole ring may impart biological activity, as pyrazole derivatives are often explored for their pharmacological properties. Additionally, the compound's solubility and stability can be influenced by the tetrahydropyran substituent, which may affect its interactions in biological systems. Overall, this compound's unique structure positions it as a potential candidate for further research in drug development and synthetic methodologies.
Formula:C8H13BN2O3
InChI:InChI=1S/C8H13BN2O3/c12-9(13)7-4-5-10-11(7)8-3-1-2-6-14-8/h4-5,8,12-13H,1-3,6H2
InChI key:InChIKey=YRADCPLKXBTOTI-UHFFFAOYSA-N
SMILES:OB(O)C1=CC=NN1C2OCCCC2
- Synonyms:
- B-[1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl]boronic acid
- [1-(Oxan-2-yl)-1H-pyrazol-5-yl]boronic acid
- Boronic acid, B-[1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl]-
- [1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl]boronic acid
- 1-(Tetrahydropyran-2-yl)pyrazole-5-boronic acid

(1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl)boronic acid
Ref: IN-DA003BEI
250mg | 190.00 € |

Ref: 54-OR360463
Undefined size | To inquire |

(1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl)boronic acid
Ref: 10-F620086
100mg | To inquire | ||
250mg | To inquire |

(1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl)boronic acid
Ref: 3D-FT159932
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |