CAS 1105662-61-0: 1,1-Dimethylethyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-3-(hydroxymethyl)-1-azetidinecarboxylate
Description:1,1-Dimethylethyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-3-(hydroxymethyl)-1-azetidinecarboxylate is a complex organic compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This substance features multiple functional groups, including an amino group, a hydroxymethyl group, and an ester group, contributing to its reactivity and potential applications in organic synthesis. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric hindrance, which can influence its chemical behavior and interactions. The compound's solubility and stability are likely affected by the bulky substituents and polar functional groups. As a derivative of azetidine, it may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require experimental determination or detailed literature references for precise values. Overall, this compound represents a unique structure that may have implications in various fields, including pharmaceuticals and materials science.
Formula:C14H26N2O5
InChI:InChI=1S/C14H26N2O5/c1-12(2,3)20-10(18)15-14(9-17)7-16(8-14)11(19)21-13(4,5)6/h17H,7-9H2,1-6H3,(H,15,18)
InChI key:InChIKey=CPHVKOAKKZUZJT-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)NC1(CO)CN(C(=O)OC(C)(C)C)C1
- Synonyms:
- 1-Boc-3-(Boc-amino)azetidine-3-methanol
- 1,1-Dimethylethyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-3-(hydroxymethyl)-1-azetidinecarboxylate
- 1-Azetidinecarboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-3-(hydroxymethyl)-, 1,1-dimethylethyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Boc-3-(Boc-amino)azetidine-3-methanol REF: IN-DA00HBQSCAS: 1105662-61-0 | 97% | To inquire | Thu 27 Mar 25 |
![]() | 1-BOC-3-(BOC-AMINO)AZETIDINE-3-METHANOL REF: 10-F503384CAS: 1105662-61-0 | 95.0% | - - - | Discontinued product |
![]() | 1-boc-3-(boc-amino)azetidine-3-methanol REF: 3D-FUB66261CAS: 1105662-61-0 | Min. 95% | - - - | Discontinued product |

1-Boc-3-(Boc-amino)azetidine-3-methanol
Ref: IN-DA00HBQS
1g | To inquire | ||
250mg | 573.00 € | ||
500mg | 628.00 € |

1-BOC-3-(BOC-AMINO)AZETIDINE-3-METHANOL
Ref: 10-F503384
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

1-boc-3-(boc-amino)azetidine-3-methanol
Ref: 3D-FUB66261
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
5mg | Discontinued | Request information | |
50mg | Discontinued | Request information |