CAS 1107694-85-8: 2-Chloro-5-iodo-4-quinazolinamine

Description:2-Chloro-5-iodo-4-quinazolinamine is a heterocyclic organic compound characterized by the presence of a quinazoline ring, which is a bicyclic structure containing both benzene and pyrimidine components. The compound features a chlorine atom at the 2-position and an iodine atom at the 5-position of the quinazoline ring, along with an amino group at the 4-position, contributing to its reactivity and potential biological activity. This substitution pattern can influence its solubility, stability, and interaction with biological targets. The presence of halogens (chlorine and iodine) often enhances the compound's lipophilicity and can affect its pharmacokinetic properties. 2-Chloro-5-iodo-4-quinazolinamine may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific applications and efficacy would depend on further studies, including its mechanism of action and potential therapeutic uses. As with many quinazoline derivatives, it may also serve as a scaffold for the development of novel pharmaceuticals.

Formula:C₈H₅ClIN₃

InChI:InChI=1S/C8H5ClIN3/c9-8-12-5-3-1-2-4(10)6(5)7(11)13-8/h1-3H,(H2,11,12,13)

InChI key:InChIKey=QCYVUPMEGWRUDZ-UHFFFAOYSA-N

SMILES:ClC=1N=C(N)C=2C(I)=CC=CC2N1

Synonyms:
4-Quinazolinamine, 2-chloro-5-iodo-
2-Chloro-5-iodo-4-quinazolinamine

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2-chloro-5-iodoquinazolin-4-aMine REF: IN-DA00926CCAS: 1107694-85-8	- - -	To inquire	Mon 03 Mar 25
2-Chloro-5-iodoquinazolin-4-amine REF: 10-F765994CAS: 1107694-85-8	98%	- - -	Discontinued product
2-Chloro-5-iodoquinazolin-4-amine REF: 3D-FC43450CAS: 1107694-85-8	Min. 95%	- - -	Discontinued product