CAS 111080-65-0: 4-(BOC-AMINOMETHYL)PYRIDINE
Description:4-(BOC-Aminomethyl)pyridine, with the CAS number 111080-65-0, is a chemical compound characterized by its pyridine ring substituted with a BOC (tert-butyloxycarbonyl) protected aminomethyl group. This compound typically appears as a solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but may have limited solubility in water. The BOC group serves as a protective moiety for the amine, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The presence of the pyridine ring contributes to its basicity and potential reactivity in nucleophilic substitution reactions. Additionally, the compound can be utilized in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals, due to its functionalized nature. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.
Formula:C11H16N2O2
InChI:InChI=1/C11H16N2O2/c1-11(2,3)15-10(14)13-8-9-4-6-12-7-5-9/h4-7H,8H2,1-3H3,(H,13,14)
InChI key:InChIKey=KXCFJDZVQLRYSI-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)NCC=1C=CN=CC1
- Synonyms:
- 1,1-Dimethylethyl N-(4-pyridinylmethyl)carbamate
- 4-(Boc-aminomethyl)pyridine ,97%
- 4-(tert-Butoxycarbonylamino)methylpyridine
- 4-[(Tert-Butoxycarbonylamino)Methyl]Pyridine
- Carbamic acid, (4-pyridinylmethyl)-, 1,1-dimethylethyl ester
- Carbamic acid, (4-pyridinylmethyl)-, 1,1-dimethylethyl ester (9CI)
- Carbamic acid, N-(4-pyridinylmethyl)-, 1,1-dimethylethyl ester
- N-Boc-4-Aminomethylpyridine
- Tert-Butyl (Pyridin-4-Ylmethyl)Carbamate
- [(Pyridin-4-yl)methyl]carbamic acid tert-butyl ester
- See more synonyms