CAS 111138-83-1: Benzyl N,N-Dibenzyl-L-Phenylalaninate
Description:Benzyl N,N-Dibenzyl-L-Phenylalaninate is an organic compound characterized by its structure, which includes a phenylalanine derivative with two benzyl groups attached to the nitrogen atom of the amine. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water. It is often used in organic synthesis and pharmaceutical applications due to its potential as a chiral auxiliary or intermediate in the production of various biologically active compounds. The presence of the phenylalanine moiety contributes to its biological relevance, as phenylalanine is an essential amino acid involved in protein synthesis. Additionally, the compound may exhibit specific optical activity due to its chiral nature, making it useful in asymmetric synthesis. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, Benzyl N,N-Dibenzyl-L-Phenylalaninate is notable for its structural complexity and potential applications in medicinal chemistry.
Formula:C30H29NO2
InChI:InChI=1/C30H29NO2/c32-30(33-24-28-19-11-4-12-20-28)29(21-25-13-5-1-6-14-25)31(22-26-15-7-2-8-16-26)23-27-17-9-3-10-18-27/h1-20,29H,21-24H2/t29-/m0/s1
- Synonyms:
- (S)-2-Dibenzylamino-3-phenyl-propionic acid benzyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | BENZYL N,N-DIBENZYL-L-PHENYLALANINATE REF: IN-DA007TPKCAS: 111138-83-1 | - - - | To inquire | Thu 27 Mar 25 |
![]() | L-N,N-Dibenzylphenylalanine benzyl ester REF: 3D-FD21564CAS: 111138-83-1 | Min. 95% | - - - | Discontinued product |

BENZYL N,N-DIBENZYL-L-PHENYLALANINATE
Ref: IN-DA007TPK
Undefined size | To inquire |

L-N,N-Dibenzylphenylalanine benzyl ester
Ref: 3D-FD21564
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |