CAS 1111638-74-4: 4-(3-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine
Description:4-(3-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with both a pyrazole and a methylthio group. The presence of the iodine atom on the pyrazole ring enhances its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic molecule, which may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery and development. The methylthio group can influence the compound's solubility and lipophilicity, affecting its pharmacokinetic properties. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of its structure. Overall, 4-(3-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine represents a class of compounds that may have significant implications in various chemical and biological applications.
Formula:C8H7IN4S
InChI:InChI=1S/C8H7IN4S/c1-14-8-10-3-2-6(12-8)5-4-11-13-7(5)9/h2-4H,1H3,(H,11,13)
InChI key:InChIKey=XBRURAHDFBJPMJ-UHFFFAOYSA-N
SMILES:IC1=NNC=C1C=2N=C(N=CC2)SC
- Synonyms:
- 3-Iodo-4-(2-(methylthio)pyrimidin-4-yl)-1H-pyrazole
- Pyrimidine, 4-(3-iodo-1H-pyrazol-4-yl)-2-(methylthio)-
- 4-(5-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine
- 4-(3-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(3-iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine REF: IN-DA007TPBCAS: 1111638-74-4 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 4-(5-iodo-1H-pyrazol-4-yl)-2-methylsulfanylpyrimidine REF: 10-F601844CAS: 1111638-74-4 | 97% | - - - | Discontinued product |
![]() | 4-(3-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine REF: 3D-FI44332CAS: 1111638-74-4 | Min. 95% | - - - | Discontinued product |

4-(3-iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine
Ref: IN-DA007TPB
Undefined size | To inquire |

4-(5-iodo-1H-pyrazol-4-yl)-2-methylsulfanylpyrimidine
Ref: 10-F601844
1g | Discontinued | Request information |

4-(3-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine
Ref: 3D-FI44332
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |